About 2-propan-2-yl-1H-pyrrole
2-propan-2-yl-1H-pyrrole (PubChem CID 527532) has the molecular formula C7H11N
and a molecular weight of 109.17 g/mol. Its IUPAC name is 2-propan-2-yl-1H-pyrrole.
Molecular Properties
| Compound Name | 2-propan-2-yl-1H-pyrrole |
| PubChem CID | 527532 |
| Molecular Formula | C7H11N |
| Molecular Weight | 109.17 g/mol |
| Exact Mass | 109.09 |
| IUPAC Name | 2-propan-2-yl-1H-pyrrole |
| SMILES | CC(C)c1ccc[nH]1 |
| InChI | InChI=1S/C7H11N/c1-6(2)7-4-3-5-8-7/h3-6,8H,1-2H3 |
| InChIKey | YYUISDWOKJLVMA-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 15.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 109.17 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze 2-propan-2-yl-1H-pyrrole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-propan-2-yl-1H-pyrrole?
The IUPAC name of 2-propan-2-yl-1H-pyrrole (CID 527532) is 2-propan-2-yl-1H-pyrrole.
What is the SMILES notation for 2-propan-2-yl-1H-pyrrole?
The canonical SMILES for 2-propan-2-yl-1H-pyrrole is CC(C)c1ccc[nH]1.
What is the InChIKey of 2-propan-2-yl-1H-pyrrole?
The InChIKey is YYUISDWOKJLVMA-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H11N/c1-6(2)7-4-3-5-8-7/h3-6,8H,1-2H3.
What are the key properties of 2-propan-2-yl-1H-pyrrole?
2-propan-2-yl-1H-pyrrole has a molecular weight of 109.17 g/mol, XLogP of 2.14, 1 rotatable bonds, 1 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 2-propan-2-yl-1H-pyrrole is sourced from PubChem (CID 527532), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).