C28H42O3 — CID 5275473
2-[(2E,6E,10E,14R)-15-hydroxy-3,7,11,14,15-pentamethylhexadeca-2,6,10-trienyl]-6-methylcyclohexa-2,5-diene-1,4-dione (PubChem CID 5275473) has the molecular formula C28H42O3 and a molecular weight of 426.64 g/mol. Its IUPAC name is 2-[(2E,6E,10E,14R)-15-hydroxy-3,7,11,14,15-pentamethylhexadeca-2,6,10-trienyl]-6-methylcyclohexa-2,5-diene-1,4-dione.
| Compound Name | 2-[(2E,6E,10E,14R)-15-hydroxy-3,7,11,14,15-pentamethylhexadeca-2,6,10-trienyl]-6-methylcyclohexa-2,5-diene-1,4-dione |
|---|---|
| PubChem CID | 5275473 |
| Molecular Formula | C28H42O3 |
| Molecular Weight | 426.64 g/mol |
| Exact Mass | 426.31 |
| IUPAC Name | 2-[(2E,6E,10E,14R)-15-hydroxy-3,7,11,14,15-pentamethylhexadeca-2,6,10-trienyl]-6-methylcyclohexa-2,5-diene-1,4-dione |
| SMILES | CC1=CC(=O)C=C(C/C=C(\C)CC/C=C(\C)CC/C=C(\C)CC[C@@H](C)C(C)(C)O)C1=O |
| InChI | InChI=1S/C28H42O3/c1-20(10-8-12-21(2)14-16-24(5)28(6,7)31)11-9-13-22(3)15-17-25-19-26(29)18-23(4)27(25)30/h11-12,15,18-19,24,31H,8-10,13-14,16-17H2,1-7H3/b20-11+,21-12+,22-15+/t24-/m1/s1 |
| InChIKey | PPQYJNSFQKSDLN-SLCNXHHWSA-N |
| XLogP | 6.99 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.64 |
| LogP ≤ 5 | 6.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|