C20H32O2 — CID 5275512
3-methylbut-2-enyl (2E,6E)-3,7,11-trimethyldodeca-2,6,10-trienoate (PubChem CID 5275512) has the molecular formula C20H32O2 and a molecular weight of 304.47 g/mol. Its IUPAC name is 3-methylbut-2-enyl (2E,6E)-3,7,11-trimethyldodeca-2,6,10-trienoate.
| Compound Name | 3-methylbut-2-enyl (2E,6E)-3,7,11-trimethyldodeca-2,6,10-trienoate |
|---|---|
| PubChem CID | 5275512 |
| Molecular Formula | C20H32O2 |
| Molecular Weight | 304.47 g/mol |
| Exact Mass | 304.24 |
| IUPAC Name | 3-methylbut-2-enyl (2E,6E)-3,7,11-trimethyldodeca-2,6,10-trienoate |
| SMILES | CC(C)=CCC/C(C)=C/CC/C(C)=C/C(=O)OCC=C(C)C |
| InChI | InChI=1S/C20H32O2/c1-16(2)9-7-10-18(5)11-8-12-19(6)15-20(21)22-14-13-17(3)4/h9,11,13,15H,7-8,10,12,14H2,1-6H3/b18-11+,19-15+ |
| InChIKey | HANFCYHBYAURNN-CFBAGHHKSA-N |
| XLogP | 5.91 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.47 |
| LogP ≤ 5 | 5.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|