C25H40O2 — CID 5275513
[(2E)-3,7-dimethylocta-2,6-dienyl] (2E,6E)-3,7,11-trimethyldodeca-2,6,10-trienoate (PubChem CID 5275513) has the molecular formula C25H40O2 and a molecular weight of 372.59 g/mol. Its IUPAC name is [(2E)-3,7-dimethylocta-2,6-dienyl] (2E,6E)-3,7,11-trimethyldodeca-2,6,10-trienoate.
| Compound Name | [(2E)-3,7-dimethylocta-2,6-dienyl] (2E,6E)-3,7,11-trimethyldodeca-2,6,10-trienoate |
|---|---|
| PubChem CID | 5275513 |
| Molecular Formula | C25H40O2 |
| Molecular Weight | 372.59 g/mol |
| Exact Mass | 372.30 |
| IUPAC Name | [(2E)-3,7-dimethylocta-2,6-dienyl] (2E,6E)-3,7,11-trimethyldodeca-2,6,10-trienoate |
| SMILES | CC(C)=CCC/C(C)=C/CC/C(C)=C/C(=O)OC/C=C(\C)CCC=C(C)C |
| InChI | InChI=1S/C25H40O2/c1-20(2)11-8-13-22(5)15-10-16-24(7)19-25(26)27-18-17-23(6)14-9-12-21(3)4/h11-12,15,17,19H,8-10,13-14,16,18H2,1-7H3/b22-15+,23-17+,24-19+ |
| InChIKey | HAUAFWLDEOQOCI-HQEXXCOVSA-N |
| XLogP | 7.64 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.59 |
| LogP ≤ 5 | 7.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|