C30H48O2 — CID 5275514
[(2E,6E)-3,7,11-trimethyldodeca-2,6,10-trienyl] (2E,6E)-3,7,11-trimethyldodeca-2,6,10-trienoate (PubChem CID 5275514) has the molecular formula C30H48O2 and a molecular weight of 440.71 g/mol. Its IUPAC name is [(2E,6E)-3,7,11-trimethyldodeca-2,6,10-trienyl] (2E,6E)-3,7,11-trimethyldodeca-2,6,10-trienoate.
| Compound Name | [(2E,6E)-3,7,11-trimethyldodeca-2,6,10-trienyl] (2E,6E)-3,7,11-trimethyldodeca-2,6,10-trienoate |
|---|---|
| PubChem CID | 5275514 |
| Molecular Formula | C30H48O2 |
| Molecular Weight | 440.71 g/mol |
| Exact Mass | 440.37 |
| IUPAC Name | [(2E,6E)-3,7,11-trimethyldodeca-2,6,10-trienyl] (2E,6E)-3,7,11-trimethyldodeca-2,6,10-trienoate |
| SMILES | CC(C)=CCC/C(C)=C/CC/C(C)=C/COC(=O)/C=C(\C)CC/C=C(\C)CCC=C(C)C |
| InChI | InChI=1S/C30H48O2/c1-24(2)13-9-15-26(5)17-11-19-28(7)21-22-32-30(31)23-29(8)20-12-18-27(6)16-10-14-25(3)4/h13-14,17-18,21,23H,9-12,15-16,19-20,22H2,1-8H3/b26-17+,27-18+,28-21+,29-23+ |
| InChIKey | YNBJYBZLJPOQTG-CEJSVNTQSA-N |
| XLogP | 9.37 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.71 |
| LogP ≤ 5 | 9.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|