C15H25NO — CID 5275515
(2E,6E)-3,7,11-trimethyldodeca-2,6,10-trienamide (PubChem CID 5275515) has the molecular formula C15H25NO and a molecular weight of 235.37 g/mol. Its IUPAC name is (2E,6E)-3,7,11-trimethyldodeca-2,6,10-trienamide.
| Compound Name | (2E,6E)-3,7,11-trimethyldodeca-2,6,10-trienamide |
|---|---|
| PubChem CID | 5275515 |
| Molecular Formula | C15H25NO |
| Molecular Weight | 235.37 g/mol |
| Exact Mass | 235.19 |
| IUPAC Name | (2E,6E)-3,7,11-trimethyldodeca-2,6,10-trienamide |
| SMILES | CC(C)=CCC/C(C)=C/CC/C(C)=C/C(N)=O |
| InChI | InChI=1S/C15H25NO/c1-12(2)7-5-8-13(3)9-6-10-14(4)11-15(16)17/h7,9,11H,5-6,8,10H2,1-4H3,(H2,16,17)/b13-9+,14-11+ |
| InChIKey | PIHKEQFAZPGFSS-IJFRVEDASA-N |
| XLogP | 3.89 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.37 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|