C17H29NO — CID 5275517
(2E,6E)-N,N,3,7,11-pentamethyldodeca-2,6,10-trienamide (PubChem CID 5275517) has the molecular formula C17H29NO and a molecular weight of 263.43 g/mol. Its IUPAC name is (2E,6E)-N,N,3,7,11-pentamethyldodeca-2,6,10-trienamide.
| Compound Name | (2E,6E)-N,N,3,7,11-pentamethyldodeca-2,6,10-trienamide |
|---|---|
| PubChem CID | 5275517 |
| Molecular Formula | C17H29NO |
| Molecular Weight | 263.43 g/mol |
| Exact Mass | 263.22 |
| IUPAC Name | (2E,6E)-N,N,3,7,11-pentamethyldodeca-2,6,10-trienamide |
| SMILES | CC(C)=CCC/C(C)=C/CC/C(C)=C/C(=O)N(C)C |
| InChI | InChI=1S/C17H29NO/c1-14(2)9-7-10-15(3)11-8-12-16(4)13-17(19)18(5)6/h9,11,13H,7-8,10,12H2,1-6H3/b15-11+,16-13+ |
| InChIKey | OXLKXVXFHQSCFD-NWFDBUFXSA-N |
| XLogP | 4.49 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.43 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|