C18H29NO — CID 5275518
(2E,6E)-3,7,11-trimethyl-N-prop-2-enyldodeca-2,6,10-trienamide (PubChem CID 5275518) has the molecular formula C18H29NO and a molecular weight of 275.44 g/mol. Its IUPAC name is (2E,6E)-3,7,11-trimethyl-N-prop-2-enyldodeca-2,6,10-trienamide.
| Compound Name | (2E,6E)-3,7,11-trimethyl-N-prop-2-enyldodeca-2,6,10-trienamide |
|---|---|
| PubChem CID | 5275518 |
| Molecular Formula | C18H29NO |
| Molecular Weight | 275.44 g/mol |
| Exact Mass | 275.22 |
| IUPAC Name | (2E,6E)-3,7,11-trimethyl-N-prop-2-enyldodeca-2,6,10-trienamide |
| SMILES | C=CCNC(=O)/C=C(\C)CC/C=C(\C)CCC=C(C)C |
| InChI | InChI=1S/C18H29NO/c1-6-13-19-18(20)14-17(5)12-8-11-16(4)10-7-9-15(2)3/h6,9,11,14H,1,7-8,10,12-13H2,2-5H3,(H,19,20)/b16-11+,17-14+ |
| InChIKey | NUAWRWSFYJYUMW-GIROIBLESA-N |
| XLogP | 4.71 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.44 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|