C15H18O4S — CID 5275630
methyl (2Z,4E,6E)-3,5-dimethoxy-4-methyl-7-thiophen-2-ylhepta-2,4,6-trienoate (PubChem CID 5275630) has the molecular formula C15H18O4S and a molecular weight of 294.37 g/mol. Its IUPAC name is methyl (2Z,4E,6E)-3,5-dimethoxy-4-methyl-7-thiophen-2-ylhepta-2,4,6-trienoate.
| Compound Name | methyl (2Z,4E,6E)-3,5-dimethoxy-4-methyl-7-thiophen-2-ylhepta-2,4,6-trienoate |
|---|---|
| PubChem CID | 5275630 |
| Molecular Formula | C15H18O4S |
| Molecular Weight | 294.37 g/mol |
| Exact Mass | 294.09 |
| IUPAC Name | methyl (2Z,4E,6E)-3,5-dimethoxy-4-methyl-7-thiophen-2-ylhepta-2,4,6-trienoate |
| SMILES | COC(=O)/C=C(OC)/C(C)=C(\C=C\c1cccs1)OC |
| InChI | InChI=1S/C15H18O4S/c1-11(14(18-3)10-15(16)19-4)13(17-2)8-7-12-6-5-9-20-12/h5-10H,1-4H3/b8-7+,13-11+,14-10- |
| InChIKey | IABNYTFVXLTFTI-MOFNYNIKSA-N |
| XLogP | 3.38 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.37 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|