cis-(1R,2S)-2-aminocyclobutane-1-carboxylic acid

C5H9NO2 — CID 5275644

IUPACcis-(1R,2S)-2-aminocyclobutane-1-carboxylic acid
SMILESN[C@H]1CC[C@H]1C(=O)O
InChIInChI=1S/C5H9NO2/c6-4-2-1-3(4)5(7)8/h3-4H,1-2,6H2,(H,7,8)/t3-,4+/m1/s1
InChIKeyNSQMWZLLTGEDQU-DMTCNVIQSA-N
MW115.13 g/mol
LogP-0.19
Rot. Bonds1

About cis-(1R,2S)-2-aminocyclobutane-1-carboxylic acid

cis-(1R,2S)-2-aminocyclobutane-1-carboxylic acid (PubChem CID 5275644) has the molecular formula C5H9NO2 and a molecular weight of 115.13 g/mol. Its IUPAC name is cis-(1R,2S)-2-aminocyclobutane-1-carboxylic acid.

Molecular Properties

Compound Namecis-(1R,2S)-2-aminocyclobutane-1-carboxylic acid
PubChem CID5275644
Molecular FormulaC5H9NO2
Molecular Weight115.13 g/mol
Exact Mass115.06
IUPAC Namecis-(1R,2S)-2-aminocyclobutane-1-carboxylic acid
SMILESN[C@H]1CC[C@H]1C(=O)O
InChIInChI=1S/C5H9NO2/c6-4-2-1-3(4)5(7)8/h3-4H,1-2,6H2,(H,7,8)/t3-,4+/m1/s1
InChIKeyNSQMWZLLTGEDQU-DMTCNVIQSA-N
XLogP-0.19
TPSA63.32 Ų
H-Bond Donors2
H-Bond Acceptors2
Rotatable Bonds1
Heavy Atoms8
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500115.13
LogP ≤ 5-0.19
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 102

Analyze cis-(1R,2S)-2-aminocyclobutane-1-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of cis-(1R,2S)-2-aminocyclobutane-1-carboxylic acid?
The IUPAC name of cis-(1R,2S)-2-aminocyclobutane-1-carboxylic acid (CID 5275644) is cis-(1R,2S)-2-aminocyclobutane-1-carboxylic acid.
What is the SMILES notation for cis-(1R,2S)-2-aminocyclobutane-1-carboxylic acid?
The canonical SMILES for cis-(1R,2S)-2-aminocyclobutane-1-carboxylic acid is N[C@H]1CC[C@H]1C(=O)O.
What is the InChIKey of cis-(1R,2S)-2-aminocyclobutane-1-carboxylic acid?
The InChIKey is NSQMWZLLTGEDQU-DMTCNVIQSA-N. The full InChI is InChI=1S/C5H9NO2/c6-4-2-1-3(4)5(7)8/h3-4H,1-2,6H2,(H,7,8)/t3-,4+/m1/s1.
What are the key properties of cis-(1R,2S)-2-aminocyclobutane-1-carboxylic acid?
cis-(1R,2S)-2-aminocyclobutane-1-carboxylic acid has a molecular weight of 115.13 g/mol, XLogP of -0.19, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for cis-(1R,2S)-2-aminocyclobutane-1-carboxylic acid is sourced from PubChem (CID 5275644), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).