cis-(1R,2S)-2-aminocyclopentane-1-sulfonic acid

C5H11NO3S — CID 5275675

IUPACcis-(1R,2S)-2-aminocyclopentane-1-sulfonic acid
SMILESN[C@H]1CCC[C@H]1S(=O)(=O)O
InChIInChI=1S/C5H11NO3S/c6-4-2-1-3-5(4)10(7,8)9/h4-5H,1-3,6H2,(H,7,8,9)/t4-,5+/m0/s1
InChIKeyDNTFEAHNXKUSKQ-CRCLSJGQSA-N
MW165.21 g/mol
LogP-0.25
Rot. Bonds1

About cis-(1R,2S)-2-aminocyclopentane-1-sulfonic acid

cis-(1R,2S)-2-aminocyclopentane-1-sulfonic acid (PubChem CID 5275675) has the molecular formula C5H11NO3S and a molecular weight of 165.21 g/mol. Its IUPAC name is cis-(1R,2S)-2-aminocyclopentane-1-sulfonic acid.

Molecular Properties

Compound Namecis-(1R,2S)-2-aminocyclopentane-1-sulfonic acid
PubChem CID5275675
Molecular FormulaC5H11NO3S
Molecular Weight165.21 g/mol
Exact Mass165.05
IUPAC Namecis-(1R,2S)-2-aminocyclopentane-1-sulfonic acid
SMILESN[C@H]1CCC[C@H]1S(=O)(=O)O
InChIInChI=1S/C5H11NO3S/c6-4-2-1-3-5(4)10(7,8)9/h4-5H,1-3,6H2,(H,7,8,9)/t4-,5+/m0/s1
InChIKeyDNTFEAHNXKUSKQ-CRCLSJGQSA-N
XLogP-0.25
TPSA80.39 Ų
H-Bond Donors2
H-Bond Acceptors3
Rotatable Bonds1
Heavy Atoms10
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500165.21
LogP ≤ 5-0.25
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 103

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}

Analyze cis-(1R,2S)-2-aminocyclopentane-1-sulfonic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of cis-(1R,2S)-2-aminocyclopentane-1-sulfonic acid?
The IUPAC name of cis-(1R,2S)-2-aminocyclopentane-1-sulfonic acid (CID 5275675) is cis-(1R,2S)-2-aminocyclopentane-1-sulfonic acid.
What is the SMILES notation for cis-(1R,2S)-2-aminocyclopentane-1-sulfonic acid?
The canonical SMILES for cis-(1R,2S)-2-aminocyclopentane-1-sulfonic acid is N[C@H]1CCC[C@H]1S(=O)(=O)O.
What is the InChIKey of cis-(1R,2S)-2-aminocyclopentane-1-sulfonic acid?
The InChIKey is DNTFEAHNXKUSKQ-CRCLSJGQSA-N. The full InChI is InChI=1S/C5H11NO3S/c6-4-2-1-3-5(4)10(7,8)9/h4-5H,1-3,6H2,(H,7,8,9)/t4-,5+/m0/s1.
What are the key properties of cis-(1R,2S)-2-aminocyclopentane-1-sulfonic acid?
cis-(1R,2S)-2-aminocyclopentane-1-sulfonic acid has a molecular weight of 165.21 g/mol, XLogP of -0.25, 1 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for cis-(1R,2S)-2-aminocyclopentane-1-sulfonic acid is sourced from PubChem (CID 5275675), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).