About (2S)-2-[[(1R,2S)-2-amino-4-methylidenecyclopentanecarbonyl]amino]-4-methylpentanoic acid
(2S)-2-[[(1R,2S)-2-amino-4-methylidenecyclopentanecarbonyl]amino]-4-methylpentanoic acid (PubChem CID 5275678) has the molecular formula C13H22N2O3
and a molecular weight of 254.33 g/mol. Its IUPAC name is (2S)-2-[[(1R,2S)-2-amino-4-methylidenecyclopentanecarbonyl]amino]-4-methylpentanoic acid.
Molecular Properties
| Compound Name | (2S)-2-[[(1R,2S)-2-amino-4-methylidenecyclopentanecarbonyl]amino]-4-methylpentanoic acid |
| PubChem CID | 5275678 |
| Molecular Formula | C13H22N2O3 |
| Molecular Weight | 254.33 g/mol |
| Exact Mass | 254.16 |
| IUPAC Name | (2S)-2-[[(1R,2S)-2-amino-4-methylidenecyclopentanecarbonyl]amino]-4-methylpentanoic acid |
| SMILES | C=C1C[C@H](N)[C@H](C(=O)N[C@@H](CC(C)C)C(=O)O)C1 |
| InChI | InChI=1S/C13H22N2O3/c1-7(2)4-11(13(17)18)15-12(16)9-5-8(3)6-10(9)14/h7,9-11H,3-6,14H2,1-2H3,(H,15,16)(H,17,18)/t9-,10+,11+/m1/s1 |
| InChIKey | HIJAURCGEQJYDS-VWYCJHECSA-N |
| XLogP | 0.90 |
| TPSA | 92.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 254.33 |
| LogP ≤ 5 | 0.90 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (2S)-2-[[(1R,2S)-2-amino-4-methylidenecyclopentanecarbonyl]amino]-4-methylpentanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2S)-2-[[(1R,2S)-2-amino-4-methylidenecyclopentanecarbonyl]amino]-4-methylpentanoic acid?
The IUPAC name of (2S)-2-[[(1R,2S)-2-amino-4-methylidenecyclopentanecarbonyl]amino]-4-methylpentanoic acid (CID 5275678) is (2S)-2-[[(1R,2S)-2-amino-4-methylidenecyclopentanecarbonyl]amino]-4-methylpentanoic acid.
What is the SMILES notation for (2S)-2-[[(1R,2S)-2-amino-4-methylidenecyclopentanecarbonyl]amino]-4-methylpentanoic acid?
The canonical SMILES for (2S)-2-[[(1R,2S)-2-amino-4-methylidenecyclopentanecarbonyl]amino]-4-methylpentanoic acid is C=C1C[C@H](N)[C@H](C(=O)N[C@@H](CC(C)C)C(=O)O)C1.
What is the InChIKey of (2S)-2-[[(1R,2S)-2-amino-4-methylidenecyclopentanecarbonyl]amino]-4-methylpentanoic acid?
The InChIKey is HIJAURCGEQJYDS-VWYCJHECSA-N. The full InChI is InChI=1S/C13H22N2O3/c1-7(2)4-11(13(17)18)15-12(16)9-5-8(3)6-10(9)14/h7,9-11H,3-6,14H2,1-2H3,(H,15,16)(H,17,18)/t9-,10+,11+/m1/s1.
What are the key properties of (2S)-2-[[(1R,2S)-2-amino-4-methylidenecyclopentanecarbonyl]amino]-4-methylpentanoic acid?
(2S)-2-[[(1R,2S)-2-amino-4-methylidenecyclopentanecarbonyl]amino]-4-methylpentanoic acid has a molecular weight of 254.33 g/mol, XLogP of 0.90, 5 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2S)-2-[[(1R,2S)-2-amino-4-methylidenecyclopentanecarbonyl]amino]-4-methylpentanoic acid is sourced from PubChem (CID 5275678), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).