C27H32FN7O — CID 5275695
N-butyl-2-(4-fluorophenyl)-3-[2-(2-morpholin-4-ylethylamino)pyrimidin-4-yl]pyrazolo[1,5-a]pyridin-7-amine (PubChem CID 5275695) has the molecular formula C27H32FN7O and a molecular weight of 489.60 g/mol. Its IUPAC name is N-butyl-2-(4-fluorophenyl)-3-[2-(2-morpholin-4-ylethylamino)pyrimidin-4-yl]pyrazolo[1,5-a]pyridin-7-amine.
| Compound Name | N-butyl-2-(4-fluorophenyl)-3-[2-(2-morpholin-4-ylethylamino)pyrimidin-4-yl]pyrazolo[1,5-a]pyridin-7-amine |
|---|---|
| PubChem CID | 5275695 |
| Molecular Formula | C27H32FN7O |
| Molecular Weight | 489.60 g/mol |
| Exact Mass | 489.27 |
| IUPAC Name | N-butyl-2-(4-fluorophenyl)-3-[2-(2-morpholin-4-ylethylamino)pyrimidin-4-yl]pyrazolo[1,5-a]pyridin-7-amine |
| SMILES | CCCCNc1cccc2c(-c3ccnc(NCCN4CCOCC4)n3)c(-c3ccc(F)cc3)nn12 |
| InChI | InChI=1S/C27H32FN7O/c1-2-3-12-29-24-6-4-5-23-25(26(33-35(23)24)20-7-9-21(28)10-8-20)22-11-13-30-27(32-22)31-14-15-34-16-18-36-19-17-34/h4-11,13,29H,2-3,12,14-19H2,1H3,(H,30,31,32) |
| InChIKey | RYNVQBIIRPBVGV-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 79.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.60 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|