C28H24N4O2 — CID 5275974
1-cyclohexyl-2-(3-phenylquinoxalin-6-yl)benzimidazole-5-carboxylic acid (PubChem CID 5275974) has the molecular formula C28H24N4O2 and a molecular weight of 448.53 g/mol. Its IUPAC name is 1-cyclohexyl-2-(3-phenylquinoxalin-6-yl)benzimidazole-5-carboxylic acid.
| Compound Name | 1-cyclohexyl-2-(3-phenylquinoxalin-6-yl)benzimidazole-5-carboxylic acid |
|---|---|
| PubChem CID | 5275974 |
| Molecular Formula | C28H24N4O2 |
| Molecular Weight | 448.53 g/mol |
| Exact Mass | 448.19 |
| IUPAC Name | 1-cyclohexyl-2-(3-phenylquinoxalin-6-yl)benzimidazole-5-carboxylic acid |
| SMILES | O=C(O)c1ccc2c(c1)nc(-c1ccc3ncc(-c4ccccc4)nc3c1)n2C1CCCCC1 |
| InChI | InChI=1S/C28H24N4O2/c33-28(34)20-12-14-26-24(16-20)31-27(32(26)21-9-5-2-6-10-21)19-11-13-22-23(15-19)30-25(17-29-22)18-7-3-1-4-8-18/h1,3-4,7-8,11-17,21H,2,5-6,9-10H2,(H,33,34) |
| InChIKey | OCYWAAMZOKEANA-UHFFFAOYSA-N |
| XLogP | 6.52 |
| TPSA | 80.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.53 |
| LogP ≤ 5 | 6.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |