About 2-[2,3-bis(4-methylphenyl)quinoxalin-6-yl]-1-cyclohexylbenzimidazole-5-carboxylic acid
2-[2,3-bis(4-methylphenyl)quinoxalin-6-yl]-1-cyclohexylbenzimidazole-5-carboxylic acid (PubChem CID 5276012) has the molecular formula C36H32N4O2
and a molecular weight of 552.68 g/mol. Its IUPAC name is 2-[2,3-bis(4-methylphenyl)quinoxalin-6-yl]-1-cyclohexylbenzimidazole-5-carboxylic acid.
Molecular Properties
| Compound Name | 2-[2,3-bis(4-methylphenyl)quinoxalin-6-yl]-1-cyclohexylbenzimidazole-5-carboxylic acid |
| PubChem CID | 5276012 |
| Molecular Formula | C36H32N4O2 |
| Molecular Weight | 552.68 g/mol |
| Exact Mass | 552.25 |
| IUPAC Name | 2-[2,3-bis(4-methylphenyl)quinoxalin-6-yl]-1-cyclohexylbenzimidazole-5-carboxylic acid |
| SMILES | Cc1ccc(-c2nc3ccc(-c4nc5cc(C(=O)O)ccc5n4C4CCCCC4)cc3nc2-c2ccc(C)cc2)cc1 |
| InChI | InChI=1S/C36H32N4O2/c1-22-8-12-24(13-9-22)33-34(25-14-10-23(2)11-15-25)38-30-20-26(16-18-29(30)37-33)35-39-31-21-27(36(41)42)17-19-32(31)40(35)28-6-4-3-5-7-28/h8-21,28H,3-7H2,1-2H3,(H,41,42) |
| InChIKey | ORUNKUHOZMXQOA-UHFFFAOYSA-N |
| XLogP | 8.80 |
| TPSA | 80.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 42 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 552.68 |
| LogP ≤ 5 | 8.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-[2,3-bis(4-methylphenyl)quinoxalin-6-yl]-1-cyclohexylbenzimidazole-5-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[2,3-bis(4-methylphenyl)quinoxalin-6-yl]-1-cyclohexylbenzimidazole-5-carboxylic acid?
The IUPAC name of 2-[2,3-bis(4-methylphenyl)quinoxalin-6-yl]-1-cyclohexylbenzimidazole-5-carboxylic acid (CID 5276012) is 2-[2,3-bis(4-methylphenyl)quinoxalin-6-yl]-1-cyclohexylbenzimidazole-5-carboxylic acid.
What is the SMILES notation for 2-[2,3-bis(4-methylphenyl)quinoxalin-6-yl]-1-cyclohexylbenzimidazole-5-carboxylic acid?
The canonical SMILES for 2-[2,3-bis(4-methylphenyl)quinoxalin-6-yl]-1-cyclohexylbenzimidazole-5-carboxylic acid is Cc1ccc(-c2nc3ccc(-c4nc5cc(C(=O)O)ccc5n4C4CCCCC4)cc3nc2-c2ccc(C)cc2)cc1.
What is the InChIKey of 2-[2,3-bis(4-methylphenyl)quinoxalin-6-yl]-1-cyclohexylbenzimidazole-5-carboxylic acid?
The InChIKey is ORUNKUHOZMXQOA-UHFFFAOYSA-N. The full InChI is InChI=1S/C36H32N4O2/c1-22-8-12-24(13-9-22)33-34(25-14-10-23(2)11-15-25)38-30-20-26(16-18-29(30)37-33)35-39-31-21-27(36(41)42)17-19-32(31)40(35)28-6-4-3-5-7-28/h8-21,28H,3-7H2,1-2H3,(H,41,42).
What are the key properties of 2-[2,3-bis(4-methylphenyl)quinoxalin-6-yl]-1-cyclohexylbenzimidazole-5-carboxylic acid?
2-[2,3-bis(4-methylphenyl)quinoxalin-6-yl]-1-cyclohexylbenzimidazole-5-carboxylic acid has a molecular weight of 552.68 g/mol, XLogP of 8.80, 5 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[2,3-bis(4-methylphenyl)quinoxalin-6-yl]-1-cyclohexylbenzimidazole-5-carboxylic acid is sourced from PubChem (CID 5276012), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).