C30H27N3O2 — CID 5276020
1-cyclohexyl-2-(8-methyl-2-phenylquinolin-6-yl)benzimidazole-5-carboxylic acid (PubChem CID 5276020) has the molecular formula C30H27N3O2 and a molecular weight of 461.57 g/mol. Its IUPAC name is 1-cyclohexyl-2-(8-methyl-2-phenylquinolin-6-yl)benzimidazole-5-carboxylic acid.
| Compound Name | 1-cyclohexyl-2-(8-methyl-2-phenylquinolin-6-yl)benzimidazole-5-carboxylic acid |
|---|---|
| PubChem CID | 5276020 |
| Molecular Formula | C30H27N3O2 |
| Molecular Weight | 461.57 g/mol |
| Exact Mass | 461.21 |
| IUPAC Name | 1-cyclohexyl-2-(8-methyl-2-phenylquinolin-6-yl)benzimidazole-5-carboxylic acid |
| SMILES | Cc1cc(-c2nc3cc(C(=O)O)ccc3n2C2CCCCC2)cc2ccc(-c3ccccc3)nc12 |
| InChI | InChI=1S/C30H27N3O2/c1-19-16-23(17-21-12-14-25(31-28(19)21)20-8-4-2-5-9-20)29-32-26-18-22(30(34)35)13-15-27(26)33(29)24-10-6-3-7-11-24/h2,4-5,8-9,12-18,24H,3,6-7,10-11H2,1H3,(H,34,35) |
| InChIKey | ZHGMJGQQHROZEQ-UHFFFAOYSA-N |
| XLogP | 7.43 |
| TPSA | 68.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.57 |
| LogP ≤ 5 | 7.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |