C38H35N3O4 — CID 5276080
1-cyclohexyl-2-[2-[5-(2-methoxyethoxy)-2-phenylphenyl]quinolin-6-yl]benzimidazole-5-carboxylic acid (PubChem CID 5276080) has the molecular formula C38H35N3O4 and a molecular weight of 597.72 g/mol. Its IUPAC name is 1-cyclohexyl-2-[2-[5-(2-methoxyethoxy)-2-phenylphenyl]quinolin-6-yl]benzimidazole-5-carboxylic acid.
| Compound Name | 1-cyclohexyl-2-[2-[5-(2-methoxyethoxy)-2-phenylphenyl]quinolin-6-yl]benzimidazole-5-carboxylic acid |
|---|---|
| PubChem CID | 5276080 |
| Molecular Formula | C38H35N3O4 |
| Molecular Weight | 597.72 g/mol |
| Exact Mass | 597.26 |
| IUPAC Name | 1-cyclohexyl-2-[2-[5-(2-methoxyethoxy)-2-phenylphenyl]quinolin-6-yl]benzimidazole-5-carboxylic acid |
| SMILES | COCCOc1ccc(-c2ccccc2)c(-c2ccc3cc(-c4nc5cc(C(=O)O)ccc5n4C4CCCCC4)ccc3n2)c1 |
| InChI | InChI=1S/C38H35N3O4/c1-44-20-21-45-30-15-16-31(25-8-4-2-5-9-25)32(24-30)34-18-12-26-22-27(13-17-33(26)39-34)37-40-35-23-28(38(42)43)14-19-36(35)41(37)29-10-6-3-7-11-29/h2,4-5,8-9,12-19,22-24,29H,3,6-7,10-11,20-21H2,1H3,(H,42,43) |
| InChIKey | HNLWWNWEZNYSKF-UHFFFAOYSA-N |
| XLogP | 8.81 |
| TPSA | 86.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 597.72 |
| LogP ≤ 5 | 8.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|