C34H32N4O5 — CID 5276162
2-[[1-cyclohexyl-2-(2-phenylquinolin-6-yl)benzimidazole-5-carbonyl]amino]pentanedioic acid (PubChem CID 5276162) has the molecular formula C34H32N4O5 and a molecular weight of 576.65 g/mol. Its IUPAC name is 2-[[1-cyclohexyl-2-(2-phenylquinolin-6-yl)benzimidazole-5-carbonyl]amino]pentanedioic acid.
| Compound Name | 2-[[1-cyclohexyl-2-(2-phenylquinolin-6-yl)benzimidazole-5-carbonyl]amino]pentanedioic acid |
|---|---|
| PubChem CID | 5276162 |
| Molecular Formula | C34H32N4O5 |
| Molecular Weight | 576.65 g/mol |
| Exact Mass | 576.24 |
| IUPAC Name | 2-[[1-cyclohexyl-2-(2-phenylquinolin-6-yl)benzimidazole-5-carbonyl]amino]pentanedioic acid |
| SMILES | O=C(O)CCC(NC(=O)c1ccc2c(c1)nc(-c1ccc3nc(-c4ccccc4)ccc3c1)n2C1CCCCC1)C(=O)O |
| InChI | InChI=1S/C34H32N4O5/c39-31(40)18-16-28(34(42)43)37-33(41)24-13-17-30-29(20-24)36-32(38(30)25-9-5-2-6-10-25)23-12-15-27-22(19-23)11-14-26(35-27)21-7-3-1-4-8-21/h1,3-4,7-8,11-15,17,19-20,25,28H,2,5-6,9-10,16,18H2,(H,37,41)(H,39,40)(H,42,43) |
| InChIKey | BHWNMHRXXUSLAL-UHFFFAOYSA-N |
| XLogP | 6.47 |
| TPSA | 134.41 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 576.65 |
| LogP ≤ 5 | 6.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |