C34H35FN8O3 — CID 5276202
2-[[1-cyclohexyl-2-(7-fluoro-2-phenylquinoxalin-6-yl)benzimidazole-5-carbonyl]amino]-5-(diaminomethylideneamino)pentanoic acid (PubChem CID 5276202) has the molecular formula C34H35FN8O3 and a molecular weight of 622.71 g/mol. Its IUPAC name is 2-[[1-cyclohexyl-2-(7-fluoro-2-phenylquinoxalin-6-yl)benzimidazole-5-carbonyl]amino]-5-(diaminomethylideneamino)pentanoic acid.
| Compound Name | 2-[[1-cyclohexyl-2-(7-fluoro-2-phenylquinoxalin-6-yl)benzimidazole-5-carbonyl]amino]-5-(diaminomethylideneamino)pentanoic acid |
|---|---|
| PubChem CID | 5276202 |
| Molecular Formula | C34H35FN8O3 |
| Molecular Weight | 622.71 g/mol |
| Exact Mass | 622.28 |
| IUPAC Name | 2-[[1-cyclohexyl-2-(7-fluoro-2-phenylquinoxalin-6-yl)benzimidazole-5-carbonyl]amino]-5-(diaminomethylideneamino)pentanoic acid |
| SMILES | NC(N)=NCCCC(NC(=O)c1ccc2c(c1)nc(-c1cc3ncc(-c4ccccc4)nc3cc1F)n2C1CCCCC1)C(=O)O |
| InChI | InChI=1S/C34H35FN8O3/c35-24-18-27-26(39-19-29(40-27)20-8-3-1-4-9-20)17-23(24)31-41-28-16-21(13-14-30(28)43(31)22-10-5-2-6-11-22)32(44)42-25(33(45)46)12-7-15-38-34(36)37/h1,3-4,8-9,13-14,16-19,22,25H,2,5-7,10-12,15H2,(H,42,44)(H,45,46)(H4,36,37,38) |
| InChIKey | KLBDVCVSZLUYGN-UHFFFAOYSA-N |
| XLogP | 5.19 |
| TPSA | 174.40 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 622.71 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|