C14H25NO — CID 5276210
(2S,13R)-13-amino-8-methyltricyclo[7.3.1.02,7]tridecan-2-ol (PubChem CID 5276210) has the molecular formula C14H25NO and a molecular weight of 223.36 g/mol. Its IUPAC name is (2S,13R)-13-amino-8-methyltricyclo[7.3.1.02,7]tridecan-2-ol.
| Compound Name | (2S,13R)-13-amino-8-methyltricyclo[7.3.1.02,7]tridecan-2-ol |
|---|---|
| PubChem CID | 5276210 |
| Molecular Formula | C14H25NO |
| Molecular Weight | 223.36 g/mol |
| Exact Mass | 223.19 |
| IUPAC Name | (2S,13R)-13-amino-8-methyltricyclo[7.3.1.02,7]tridecan-2-ol |
| SMILES | CC1C2CCCC([C@@H]2N)[C@]2(O)CCCCC12 |
| InChI | InChI=1S/C14H25NO/c1-9-10-5-4-7-12(13(10)15)14(16)8-3-2-6-11(9)14/h9-13,16H,2-8,15H2,1H3/t9?,10?,11?,12?,13-,14+/m1/s1 |
| InChIKey | DNQNIARBWUTCEW-RXENIJKDSA-N |
| XLogP | 2.30 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.36 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |