C19H28N2O2 — CID 5276320
N-[2-[(4aS,8aR)-3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl]ethyl]-2-hydroxy-5-methylbenzamide (PubChem CID 5276320) has the molecular formula C19H28N2O2 and a molecular weight of 316.44 g/mol. Its IUPAC name is N-[2-[(4aS,8aR)-3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl]ethyl]-2-hydroxy-5-methylbenzamide.
| Compound Name | N-[2-[(4aS,8aR)-3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl]ethyl]-2-hydroxy-5-methylbenzamide |
|---|---|
| PubChem CID | 5276320 |
| Molecular Formula | C19H28N2O2 |
| Molecular Weight | 316.44 g/mol |
| Exact Mass | 316.22 |
| IUPAC Name | N-[2-[(4aS,8aR)-3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl]ethyl]-2-hydroxy-5-methylbenzamide |
| SMILES | Cc1ccc(O)c(C(=O)NCCN2CCC[C@@H]3CCCC[C@H]32)c1 |
| InChI | InChI=1S/C19H28N2O2/c1-14-8-9-18(22)16(13-14)19(23)20-10-12-21-11-4-6-15-5-2-3-7-17(15)21/h8-9,13,15,17,22H,2-7,10-12H2,1H3,(H,20,23)/t15-,17+/m0/s1 |
| InChIKey | ZWYHLDPCWFTUNS-DOTOQJQBSA-N |
| XLogP | 3.09 |
| TPSA | 52.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.44 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |