C10H20N2O3 — CID 5276346
(2S,3R,4S)-3,4-dihydroxy-N-pentylpyrrolidine-2-carboxamide (PubChem CID 5276346) has the molecular formula C10H20N2O3 and a molecular weight of 216.28 g/mol. Its IUPAC name is (2S,3R,4S)-3,4-dihydroxy-N-pentylpyrrolidine-2-carboxamide.
| Compound Name | (2S,3R,4S)-3,4-dihydroxy-N-pentylpyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 5276346 |
| Molecular Formula | C10H20N2O3 |
| Molecular Weight | 216.28 g/mol |
| Exact Mass | 216.15 |
| IUPAC Name | (2S,3R,4S)-3,4-dihydroxy-N-pentylpyrrolidine-2-carboxamide |
| SMILES | CCCCCNC(=O)[C@H]1NC[C@H](O)[C@@H]1O |
| InChI | InChI=1S/C10H20N2O3/c1-2-3-4-5-11-10(15)8-9(14)7(13)6-12-8/h7-9,12-14H,2-6H2,1H3,(H,11,15)/t7-,8-,9-/m0/s1 |
| InChIKey | PDRDNOXBCLQZAJ-CIUDSAMLSA-N |
| XLogP | -1.01 |
| TPSA | 81.59 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.28 |
| LogP ≤ 5 | -1.01 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|