About (3-hydroxy-3,3-diphosphonopropyl)azanium
(3-hydroxy-3,3-diphosphonopropyl)azanium (PubChem CID 5276524) has the molecular formula C3H12NO7P2+
and a molecular weight of 236.08 g/mol. Its IUPAC name is (3-hydroxy-3,3-diphosphonopropyl)azanium.
Molecular Properties
| Compound Name | (3-hydroxy-3,3-diphosphonopropyl)azanium |
| PubChem CID | 5276524 |
| Molecular Formula | C3H12NO7P2+ |
| Molecular Weight | 236.08 g/mol |
| Exact Mass | 236.01 |
| IUPAC Name | (3-hydroxy-3,3-diphosphonopropyl)azanium |
| SMILES | [NH3+]CCC(O)(P(=O)(O)O)P(=O)(O)O |
| InChI | InChI=1S/C3H11NO7P2/c4-2-1-3(5,12(6,7)8)13(9,10)11/h5H,1-2,4H2,(H2,6,7,8)(H2,9,10,11)/p+1 |
| InChIKey | WRUUGTRCQOWXEG-UHFFFAOYSA-O |
| XLogP | -2.38 |
| TPSA | 162.93 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 236.08 |
| LogP ≤ 5 | -2.38 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze (3-hydroxy-3,3-diphosphonopropyl)azanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3-hydroxy-3,3-diphosphonopropyl)azanium?
The IUPAC name of (3-hydroxy-3,3-diphosphonopropyl)azanium (CID 5276524) is (3-hydroxy-3,3-diphosphonopropyl)azanium.
What is the SMILES notation for (3-hydroxy-3,3-diphosphonopropyl)azanium?
The canonical SMILES for (3-hydroxy-3,3-diphosphonopropyl)azanium is [NH3+]CCC(O)(P(=O)(O)O)P(=O)(O)O.
What is the InChIKey of (3-hydroxy-3,3-diphosphonopropyl)azanium?
The InChIKey is WRUUGTRCQOWXEG-UHFFFAOYSA-O. The full InChI is InChI=1S/C3H11NO7P2/c4-2-1-3(5,12(6,7)8)13(9,10)11/h5H,1-2,4H2,(H2,6,7,8)(H2,9,10,11)/p+1.
What are the key properties of (3-hydroxy-3,3-diphosphonopropyl)azanium?
(3-hydroxy-3,3-diphosphonopropyl)azanium has a molecular weight of 236.08 g/mol, XLogP of -2.38, 4 rotatable bonds, 6 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (3-hydroxy-3,3-diphosphonopropyl)azanium is sourced from PubChem (CID 5276524), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).