About (5-hydroxy-5,5-diphosphonopentyl)azanium
(5-hydroxy-5,5-diphosphonopentyl)azanium (PubChem CID 5276558) has the molecular formula C5H16NO7P2+
and a molecular weight of 264.13 g/mol. Its IUPAC name is (5-hydroxy-5,5-diphosphonopentyl)azanium.
Molecular Properties
| Compound Name | (5-hydroxy-5,5-diphosphonopentyl)azanium |
| PubChem CID | 5276558 |
| Molecular Formula | C5H16NO7P2+ |
| Molecular Weight | 264.13 g/mol |
| Exact Mass | 264.04 |
| IUPAC Name | (5-hydroxy-5,5-diphosphonopentyl)azanium |
| SMILES | [NH3+]CCCCC(O)(P(=O)(O)O)P(=O)(O)O |
| InChI | InChI=1S/C5H15NO7P2/c6-4-2-1-3-5(7,14(8,9)10)15(11,12)13/h7H,1-4,6H2,(H2,8,9,10)(H2,11,12,13)/p+1 |
| InChIKey | DXGBLRMRXHGUFX-UHFFFAOYSA-O |
| XLogP | -1.60 |
| TPSA | 162.93 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 264.13 |
| LogP ≤ 5 | -1.60 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze (5-hydroxy-5,5-diphosphonopentyl)azanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (5-hydroxy-5,5-diphosphonopentyl)azanium?
The IUPAC name of (5-hydroxy-5,5-diphosphonopentyl)azanium (CID 5276558) is (5-hydroxy-5,5-diphosphonopentyl)azanium.
What is the SMILES notation for (5-hydroxy-5,5-diphosphonopentyl)azanium?
The canonical SMILES for (5-hydroxy-5,5-diphosphonopentyl)azanium is [NH3+]CCCCC(O)(P(=O)(O)O)P(=O)(O)O.
What is the InChIKey of (5-hydroxy-5,5-diphosphonopentyl)azanium?
The InChIKey is DXGBLRMRXHGUFX-UHFFFAOYSA-O. The full InChI is InChI=1S/C5H15NO7P2/c6-4-2-1-3-5(7,14(8,9)10)15(11,12)13/h7H,1-4,6H2,(H2,8,9,10)(H2,11,12,13)/p+1.
What are the key properties of (5-hydroxy-5,5-diphosphonopentyl)azanium?
(5-hydroxy-5,5-diphosphonopentyl)azanium has a molecular weight of 264.13 g/mol, XLogP of -1.60, 6 rotatable bonds, 6 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (5-hydroxy-5,5-diphosphonopentyl)azanium is sourced from PubChem (CID 5276558), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).