C21H24N2O2S2 — CID 5276578
(3R,6R)-3,6-dibenzyl-1-methyl-3,6-bis(methylsulfanyl)piperazine-2,5-dione (PubChem CID 5276578) has the molecular formula C21H24N2O2S2 and a molecular weight of 400.57 g/mol. Its IUPAC name is (3R,6R)-3,6-dibenzyl-1-methyl-3,6-bis(methylsulfanyl)piperazine-2,5-dione.
| Compound Name | (3R,6R)-3,6-dibenzyl-1-methyl-3,6-bis(methylsulfanyl)piperazine-2,5-dione |
|---|---|
| PubChem CID | 5276578 |
| Molecular Formula | C21H24N2O2S2 |
| Molecular Weight | 400.57 g/mol |
| Exact Mass | 400.13 |
| IUPAC Name | (3R,6R)-3,6-dibenzyl-1-methyl-3,6-bis(methylsulfanyl)piperazine-2,5-dione |
| SMILES | CS[C@@]1(Cc2ccccc2)NC(=O)[C@@](Cc2ccccc2)(SC)N(C)C1=O |
| InChI | InChI=1S/C21H24N2O2S2/c1-23-19(25)20(26-2,14-16-10-6-4-7-11-16)22-18(24)21(23,27-3)15-17-12-8-5-9-13-17/h4-13H,14-15H2,1-3H3,(H,22,24)/t20-,21-/m1/s1 |
| InChIKey | GUIXPUVOMDJKKC-NHCUHLMSSA-N |
| XLogP | 3.18 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.57 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |