About 6-methyl-2-N,4-N-bis(4-methylpentan-2-yl)pyrimidine-2,4-diamine
6-methyl-2-N,4-N-bis(4-methylpentan-2-yl)pyrimidine-2,4-diamine (PubChem CID 5276751) has the molecular formula C17H32N4
and a molecular weight of 292.47 g/mol. Its IUPAC name is 6-methyl-2-N,4-N-bis(4-methylpentan-2-yl)pyrimidine-2,4-diamine.
Molecular Properties
| Compound Name | 6-methyl-2-N,4-N-bis(4-methylpentan-2-yl)pyrimidine-2,4-diamine |
| PubChem CID | 5276751 |
| Molecular Formula | C17H32N4 |
| Molecular Weight | 292.47 g/mol |
| Exact Mass | 292.26 |
| IUPAC Name | 6-methyl-2-N,4-N-bis(4-methylpentan-2-yl)pyrimidine-2,4-diamine |
| SMILES | Cc1cc(NC(C)CC(C)C)nc(NC(C)CC(C)C)n1 |
| InChI | InChI=1S/C17H32N4/c1-11(2)8-13(5)18-16-10-15(7)20-17(21-16)19-14(6)9-12(3)4/h10-14H,8-9H2,1-7H3,(H2,18,19,20,21) |
| InChIKey | ZHVILDUKEFLQIU-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 49.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 292.47 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 6-methyl-2-N,4-N-bis(4-methylpentan-2-yl)pyrimidine-2,4-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-methyl-2-N,4-N-bis(4-methylpentan-2-yl)pyrimidine-2,4-diamine?
The IUPAC name of 6-methyl-2-N,4-N-bis(4-methylpentan-2-yl)pyrimidine-2,4-diamine (CID 5276751) is 6-methyl-2-N,4-N-bis(4-methylpentan-2-yl)pyrimidine-2,4-diamine.
What is the SMILES notation for 6-methyl-2-N,4-N-bis(4-methylpentan-2-yl)pyrimidine-2,4-diamine?
The canonical SMILES for 6-methyl-2-N,4-N-bis(4-methylpentan-2-yl)pyrimidine-2,4-diamine is Cc1cc(NC(C)CC(C)C)nc(NC(C)CC(C)C)n1.
What is the InChIKey of 6-methyl-2-N,4-N-bis(4-methylpentan-2-yl)pyrimidine-2,4-diamine?
The InChIKey is ZHVILDUKEFLQIU-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H32N4/c1-11(2)8-13(5)18-16-10-15(7)20-17(21-16)19-14(6)9-12(3)4/h10-14H,8-9H2,1-7H3,(H2,18,19,20,21).
What are the key properties of 6-methyl-2-N,4-N-bis(4-methylpentan-2-yl)pyrimidine-2,4-diamine?
6-methyl-2-N,4-N-bis(4-methylpentan-2-yl)pyrimidine-2,4-diamine has a molecular weight of 292.47 g/mol, XLogP of 4.48, 8 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 6-methyl-2-N,4-N-bis(4-methylpentan-2-yl)pyrimidine-2,4-diamine is sourced from PubChem (CID 5276751), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).