About 5-hexyl-N,N,4-trimethyl-6-pyrrolidin-1-ylpyrimidin-2-amine
5-hexyl-N,N,4-trimethyl-6-pyrrolidin-1-ylpyrimidin-2-amine (PubChem CID 5276767) has the molecular formula C17H30N4
and a molecular weight of 290.45 g/mol. Its IUPAC name is 5-hexyl-N,N,4-trimethyl-6-pyrrolidin-1-ylpyrimidin-2-amine.
Molecular Properties
| Compound Name | 5-hexyl-N,N,4-trimethyl-6-pyrrolidin-1-ylpyrimidin-2-amine |
| PubChem CID | 5276767 |
| Molecular Formula | C17H30N4 |
| Molecular Weight | 290.45 g/mol |
| Exact Mass | 290.25 |
| IUPAC Name | 5-hexyl-N,N,4-trimethyl-6-pyrrolidin-1-ylpyrimidin-2-amine |
| SMILES | CCCCCCc1c(C)nc(N(C)C)nc1N1CCCC1 |
| InChI | InChI=1S/C17H30N4/c1-5-6-7-8-11-15-14(2)18-17(20(3)4)19-16(15)21-12-9-10-13-21/h5-13H2,1-4H3 |
| InChIKey | HXMKYIULMGJJAE-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 32.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 290.45 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 5-hexyl-N,N,4-trimethyl-6-pyrrolidin-1-ylpyrimidin-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-hexyl-N,N,4-trimethyl-6-pyrrolidin-1-ylpyrimidin-2-amine?
The IUPAC name of 5-hexyl-N,N,4-trimethyl-6-pyrrolidin-1-ylpyrimidin-2-amine (CID 5276767) is 5-hexyl-N,N,4-trimethyl-6-pyrrolidin-1-ylpyrimidin-2-amine.
What is the SMILES notation for 5-hexyl-N,N,4-trimethyl-6-pyrrolidin-1-ylpyrimidin-2-amine?
The canonical SMILES for 5-hexyl-N,N,4-trimethyl-6-pyrrolidin-1-ylpyrimidin-2-amine is CCCCCCc1c(C)nc(N(C)C)nc1N1CCCC1.
What is the InChIKey of 5-hexyl-N,N,4-trimethyl-6-pyrrolidin-1-ylpyrimidin-2-amine?
The InChIKey is HXMKYIULMGJJAE-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H30N4/c1-5-6-7-8-11-15-14(2)18-17(20(3)4)19-16(15)21-12-9-10-13-21/h5-13H2,1-4H3.
What are the key properties of 5-hexyl-N,N,4-trimethyl-6-pyrrolidin-1-ylpyrimidin-2-amine?
5-hexyl-N,N,4-trimethyl-6-pyrrolidin-1-ylpyrimidin-2-amine has a molecular weight of 290.45 g/mol, XLogP of 3.57, 7 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-hexyl-N,N,4-trimethyl-6-pyrrolidin-1-ylpyrimidin-2-amine is sourced from PubChem (CID 5276767), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).