About butan-2-yl 2-chlorobutanoate
butan-2-yl 2-chlorobutanoate (PubChem CID 527677) has the molecular formula C8H15ClO2
and a molecular weight of 178.66 g/mol. Its IUPAC name is butan-2-yl 2-chlorobutanoate.
Molecular Properties
| Compound Name | butan-2-yl 2-chlorobutanoate |
| PubChem CID | 527677 |
| Molecular Formula | C8H15ClO2 |
| Molecular Weight | 178.66 g/mol |
| Exact Mass | 178.08 |
| IUPAC Name | butan-2-yl 2-chlorobutanoate |
| SMILES | CCC(C)OC(=O)C(Cl)CC |
| InChI | InChI=1S/C8H15ClO2/c1-4-6(3)11-8(10)7(9)5-2/h6-7H,4-5H2,1-3H3 |
| InChIKey | HRJQRWBJIJWOEO-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 178.66 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze butan-2-yl 2-chlorobutanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of butan-2-yl 2-chlorobutanoate?
The IUPAC name of butan-2-yl 2-chlorobutanoate (CID 527677) is butan-2-yl 2-chlorobutanoate.
What is the SMILES notation for butan-2-yl 2-chlorobutanoate?
The canonical SMILES for butan-2-yl 2-chlorobutanoate is CCC(C)OC(=O)C(Cl)CC.
What is the InChIKey of butan-2-yl 2-chlorobutanoate?
The InChIKey is HRJQRWBJIJWOEO-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H15ClO2/c1-4-6(3)11-8(10)7(9)5-2/h6-7H,4-5H2,1-3H3.
What are the key properties of butan-2-yl 2-chlorobutanoate?
butan-2-yl 2-chlorobutanoate has a molecular weight of 178.66 g/mol, XLogP of 2.35, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for butan-2-yl 2-chlorobutanoate is sourced from PubChem (CID 527677), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).