About 5-hexyl-6-methyl-2-N,4-N-dioctylpyrimidine-2,4-diamine
5-hexyl-6-methyl-2-N,4-N-dioctylpyrimidine-2,4-diamine (PubChem CID 5276773) has the molecular formula C27H52N4
and a molecular weight of 432.74 g/mol. Its IUPAC name is 5-hexyl-6-methyl-2-N,4-N-dioctylpyrimidine-2,4-diamine.
Molecular Properties
| Compound Name | 5-hexyl-6-methyl-2-N,4-N-dioctylpyrimidine-2,4-diamine |
| PubChem CID | 5276773 |
| Molecular Formula | C27H52N4 |
| Molecular Weight | 432.74 g/mol |
| Exact Mass | 432.42 |
| IUPAC Name | 5-hexyl-6-methyl-2-N,4-N-dioctylpyrimidine-2,4-diamine |
| SMILES | CCCCCCCCNc1nc(C)c(CCCCCC)c(NCCCCCCCC)n1 |
| InChI | InChI=1S/C27H52N4/c1-5-8-11-14-16-19-22-28-26-25(21-18-13-10-7-3)24(4)30-27(31-26)29-23-20-17-15-12-9-6-2/h5-23H2,1-4H3,(H2,28,29,30,31) |
| InChIKey | PVGKMQLBQHMEGU-UHFFFAOYSA-N |
| XLogP | 8.45 |
| TPSA | 49.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 432.74 |
| LogP ≤ 5 | 8.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 5-hexyl-6-methyl-2-N,4-N-dioctylpyrimidine-2,4-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-hexyl-6-methyl-2-N,4-N-dioctylpyrimidine-2,4-diamine?
The IUPAC name of 5-hexyl-6-methyl-2-N,4-N-dioctylpyrimidine-2,4-diamine (CID 5276773) is 5-hexyl-6-methyl-2-N,4-N-dioctylpyrimidine-2,4-diamine.
What is the SMILES notation for 5-hexyl-6-methyl-2-N,4-N-dioctylpyrimidine-2,4-diamine?
The canonical SMILES for 5-hexyl-6-methyl-2-N,4-N-dioctylpyrimidine-2,4-diamine is CCCCCCCCNc1nc(C)c(CCCCCC)c(NCCCCCCCC)n1.
What is the InChIKey of 5-hexyl-6-methyl-2-N,4-N-dioctylpyrimidine-2,4-diamine?
The InChIKey is PVGKMQLBQHMEGU-UHFFFAOYSA-N. The full InChI is InChI=1S/C27H52N4/c1-5-8-11-14-16-19-22-28-26-25(21-18-13-10-7-3)24(4)30-27(31-26)29-23-20-17-15-12-9-6-2/h5-23H2,1-4H3,(H2,28,29,30,31).
What are the key properties of 5-hexyl-6-methyl-2-N,4-N-dioctylpyrimidine-2,4-diamine?
5-hexyl-6-methyl-2-N,4-N-dioctylpyrimidine-2,4-diamine has a molecular weight of 432.74 g/mol, XLogP of 8.45, 21 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-hexyl-6-methyl-2-N,4-N-dioctylpyrimidine-2,4-diamine is sourced from PubChem (CID 5276773), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).