About 3-methylbutan-2-yl 4-chlorobutanoate
3-methylbutan-2-yl 4-chlorobutanoate (PubChem CID 527697) has the molecular formula C9H17ClO2
and a molecular weight of 192.69 g/mol. Its IUPAC name is 3-methylbutan-2-yl 4-chlorobutanoate.
Molecular Properties
| Compound Name | 3-methylbutan-2-yl 4-chlorobutanoate |
| PubChem CID | 527697 |
| Molecular Formula | C9H17ClO2 |
| Molecular Weight | 192.69 g/mol |
| Exact Mass | 192.09 |
| IUPAC Name | 3-methylbutan-2-yl 4-chlorobutanoate |
| SMILES | CC(C)C(C)OC(=O)CCCCl |
| InChI | InChI=1S/C9H17ClO2/c1-7(2)8(3)12-9(11)5-4-6-10/h7-8H,4-6H2,1-3H3 |
| InChIKey | UIZNZCHJGZHQLN-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 192.69 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 3-methylbutan-2-yl 4-chlorobutanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-methylbutan-2-yl 4-chlorobutanoate?
The IUPAC name of 3-methylbutan-2-yl 4-chlorobutanoate (CID 527697) is 3-methylbutan-2-yl 4-chlorobutanoate.
What is the SMILES notation for 3-methylbutan-2-yl 4-chlorobutanoate?
The canonical SMILES for 3-methylbutan-2-yl 4-chlorobutanoate is CC(C)C(C)OC(=O)CCCCl.
What is the InChIKey of 3-methylbutan-2-yl 4-chlorobutanoate?
The InChIKey is UIZNZCHJGZHQLN-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H17ClO2/c1-7(2)8(3)12-9(11)5-4-6-10/h7-8H,4-6H2,1-3H3.
What are the key properties of 3-methylbutan-2-yl 4-chlorobutanoate?
3-methylbutan-2-yl 4-chlorobutanoate has a molecular weight of 192.69 g/mol, XLogP of 2.59, 5 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-methylbutan-2-yl 4-chlorobutanoate is sourced from PubChem (CID 527697), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).