About 1-(2-carboxyethyl)-6-[(2,3-dichlorophenyl)methyl]-4-oxoquinoline-3-carboxylic acid
1-(2-carboxyethyl)-6-[(2,3-dichlorophenyl)methyl]-4-oxoquinoline-3-carboxylic acid (PubChem CID 5276977) has the molecular formula C20H15Cl2NO5
and a molecular weight of 420.25 g/mol. Its IUPAC name is 1-(2-carboxyethyl)-6-[(2,3-dichlorophenyl)methyl]-4-oxoquinoline-3-carboxylic acid.
Molecular Properties
| Compound Name | 1-(2-carboxyethyl)-6-[(2,3-dichlorophenyl)methyl]-4-oxoquinoline-3-carboxylic acid |
| PubChem CID | 5276977 |
| Molecular Formula | C20H15Cl2NO5 |
| Molecular Weight | 420.25 g/mol |
| Exact Mass | 419.03 |
| IUPAC Name | 1-(2-carboxyethyl)-6-[(2,3-dichlorophenyl)methyl]-4-oxoquinoline-3-carboxylic acid |
| SMILES | O=C(O)CCn1cc(C(=O)O)c(=O)c2cc(Cc3cccc(Cl)c3Cl)ccc21 |
| InChI | InChI=1S/C20H15Cl2NO5/c21-15-3-1-2-12(18(15)22)8-11-4-5-16-13(9-11)19(26)14(20(27)28)10-23(16)7-6-17(24)25/h1-5,9-10H,6-8H2,(H,24,25)(H,27,28) |
| InChIKey | YUKIZQHXWJBIDQ-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 96.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 420.25 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1-(2-carboxyethyl)-6-[(2,3-dichlorophenyl)methyl]-4-oxoquinoline-3-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(2-carboxyethyl)-6-[(2,3-dichlorophenyl)methyl]-4-oxoquinoline-3-carboxylic acid?
The IUPAC name of 1-(2-carboxyethyl)-6-[(2,3-dichlorophenyl)methyl]-4-oxoquinoline-3-carboxylic acid (CID 5276977) is 1-(2-carboxyethyl)-6-[(2,3-dichlorophenyl)methyl]-4-oxoquinoline-3-carboxylic acid.
What is the SMILES notation for 1-(2-carboxyethyl)-6-[(2,3-dichlorophenyl)methyl]-4-oxoquinoline-3-carboxylic acid?
The canonical SMILES for 1-(2-carboxyethyl)-6-[(2,3-dichlorophenyl)methyl]-4-oxoquinoline-3-carboxylic acid is O=C(O)CCn1cc(C(=O)O)c(=O)c2cc(Cc3cccc(Cl)c3Cl)ccc21.
What is the InChIKey of 1-(2-carboxyethyl)-6-[(2,3-dichlorophenyl)methyl]-4-oxoquinoline-3-carboxylic acid?
The InChIKey is YUKIZQHXWJBIDQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H15Cl2NO5/c21-15-3-1-2-12(18(15)22)8-11-4-5-16-13(9-11)19(26)14(20(27)28)10-23(16)7-6-17(24)25/h1-5,9-10H,6-8H2,(H,24,25)(H,27,28).
What are the key properties of 1-(2-carboxyethyl)-6-[(2,3-dichlorophenyl)methyl]-4-oxoquinoline-3-carboxylic acid?
1-(2-carboxyethyl)-6-[(2,3-dichlorophenyl)methyl]-4-oxoquinoline-3-carboxylic acid has a molecular weight of 420.25 g/mol, XLogP of 4.07, 6 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(2-carboxyethyl)-6-[(2,3-dichlorophenyl)methyl]-4-oxoquinoline-3-carboxylic acid is sourced from PubChem (CID 5276977), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).