About 3-chlorodibenzofuran
3-chlorodibenzofuran (PubChem CID 527713) has the molecular formula C12H7ClO
and a molecular weight of 202.64 g/mol. Its IUPAC name is 3-chlorodibenzofuran.
Molecular Properties
| Compound Name | 3-chlorodibenzofuran |
| PubChem CID | 527713 |
| Molecular Formula | C12H7ClO |
| Molecular Weight | 202.64 g/mol |
| Exact Mass | 202.02 |
| IUPAC Name | 3-chlorodibenzofuran |
| SMILES | Clc1ccc2c(c1)oc1ccccc12 |
| InChI | InChI=1S/C12H7ClO/c13-8-5-6-10-9-3-1-2-4-11(9)14-12(10)7-8/h1-7H |
| InChIKey | BBOZMMAURMEVAR-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 13.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 202.64 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 3-chlorodibenzofuran with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-chlorodibenzofuran?
The IUPAC name of 3-chlorodibenzofuran (CID 527713) is 3-chlorodibenzofuran.
What is the SMILES notation for 3-chlorodibenzofuran?
The canonical SMILES for 3-chlorodibenzofuran is Clc1ccc2c(c1)oc1ccccc12.
What is the InChIKey of 3-chlorodibenzofuran?
The InChIKey is BBOZMMAURMEVAR-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H7ClO/c13-8-5-6-10-9-3-1-2-4-11(9)14-12(10)7-8/h1-7H.
What are the key properties of 3-chlorodibenzofuran?
3-chlorodibenzofuran has a molecular weight of 202.64 g/mol, XLogP of 4.24, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-chlorodibenzofuran is sourced from PubChem (CID 527713), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).