C20H20ClNO2 — CID 52771916
(E)-3-(3-chloro-4-hydroxyphenyl)-1-(4-piperidin-1-ylphenyl)prop-2-en-1-one (PubChem CID 52771916) has the molecular formula C20H20ClNO2 and a molecular weight of 341.84 g/mol. Its IUPAC name is (E)-3-(3-chloro-4-hydroxyphenyl)-1-(4-piperidin-1-ylphenyl)prop-2-en-1-one.
| Compound Name | (E)-3-(3-chloro-4-hydroxyphenyl)-1-(4-piperidin-1-ylphenyl)prop-2-en-1-one |
|---|---|
| PubChem CID | 52771916 |
| Molecular Formula | C20H20ClNO2 |
| Molecular Weight | 341.84 g/mol |
| Exact Mass | 341.12 |
| IUPAC Name | (E)-3-(3-chloro-4-hydroxyphenyl)-1-(4-piperidin-1-ylphenyl)prop-2-en-1-one |
| SMILES | O=C(/C=C/c1ccc(O)c(Cl)c1)c1ccc(N2CCCCC2)cc1 |
| InChI | InChI=1S/C20H20ClNO2/c21-18-14-15(5-11-20(18)24)4-10-19(23)16-6-8-17(9-7-16)22-12-2-1-3-13-22/h4-11,14,24H,1-3,12-13H2/b10-4+ |
| InChIKey | YDRAIGZGZNYFLW-ONNFQVAWSA-N |
| XLogP | 4.93 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.84 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|