C31H44ClNO9 — CID 5277598
(2S)-2-[(E,2S)-1-[[(1S)-1-carboxy-2-(4-chlorophenyl)ethyl]amino]-1,11-dioxooctadec-3-en-2-yl]-2-hydroxybutanedioic acid (PubChem CID 5277598) has the molecular formula C31H44ClNO9 and a molecular weight of 610.14 g/mol. Its IUPAC name is (2S)-2-[(E,2S)-1-[[(1S)-1-carboxy-2-(4-chlorophenyl)ethyl]amino]-1,11-dioxooctadec-3-en-2-yl]-2-hydroxybutanedioic acid.
| Compound Name | (2S)-2-[(E,2S)-1-[[(1S)-1-carboxy-2-(4-chlorophenyl)ethyl]amino]-1,11-dioxooctadec-3-en-2-yl]-2-hydroxybutanedioic acid |
|---|---|
| PubChem CID | 5277598 |
| Molecular Formula | C31H44ClNO9 |
| Molecular Weight | 610.14 g/mol |
| Exact Mass | 609.27 |
| IUPAC Name | (2S)-2-[(E,2S)-1-[[(1S)-1-carboxy-2-(4-chlorophenyl)ethyl]amino]-1,11-dioxooctadec-3-en-2-yl]-2-hydroxybutanedioic acid |
| SMILES | CCCCCCCC(=O)CCCCCC/C=C/[C@H](C(=O)N[C@@H](Cc1ccc(Cl)cc1)C(=O)O)[C@@](O)(CC(=O)O)C(=O)O |
| InChI | InChI=1S/C31H44ClNO9/c1-2-3-4-7-10-13-24(34)14-11-8-5-6-9-12-15-25(31(42,30(40)41)21-27(35)36)28(37)33-26(29(38)39)20-22-16-18-23(32)19-17-22/h12,15-19,25-26,42H,2-11,13-14,20-21H2,1H3,(H,33,37)(H,35,36)(H,38,39)(H,40,41)/b15-12+/t25-,26+,31+/m1/s1 |
| InChIKey | ODFGQLJINWZIJL-FJOVDUCCSA-N |
| XLogP | 5.18 |
| TPSA | 178.30 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 23 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 610.14 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|