C18H34Cl2O2 — CID 527760
2,2-dichloroethyl hexadecanoate (PubChem CID 527760) has the molecular formula C18H34Cl2O2 and a molecular weight of 353.37 g/mol. Its IUPAC name is 2,2-dichloroethyl hexadecanoate.
| Compound Name | 2,2-dichloroethyl hexadecanoate |
|---|---|
| PubChem CID | 527760 |
| Molecular Formula | C18H34Cl2O2 |
| Molecular Weight | 353.37 g/mol |
| Exact Mass | 352.19 |
| IUPAC Name | 2,2-dichloroethyl hexadecanoate |
| SMILES | CCCCCCCCCCCCCCCC(=O)OCC(Cl)Cl |
| InChI | InChI=1S/C18H34Cl2O2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-18(21)22-16-17(19)20/h17H,2-16H2,1H3 |
| InChIKey | KHCNMQCCZLLSQF-UHFFFAOYSA-N |
| XLogP | 6.81 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.37 |
| LogP ≤ 5 | 6.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|