About [7-bromo-2-[(3-chlorophenyl)methyl]-1,8-dioxopyrido[1,2-a]pyrazin-9-yl] methanesulfonate
[7-bromo-2-[(3-chlorophenyl)methyl]-1,8-dioxopyrido[1,2-a]pyrazin-9-yl] methanesulfonate (PubChem CID 5277834) has the molecular formula C16H12BrClN2O5S
and a molecular weight of 459.71 g/mol. Its IUPAC name is [7-bromo-2-[(3-chlorophenyl)methyl]-1,8-dioxopyrido[1,2-a]pyrazin-9-yl] methanesulfonate.
Molecular Properties
| Compound Name | [7-bromo-2-[(3-chlorophenyl)methyl]-1,8-dioxopyrido[1,2-a]pyrazin-9-yl] methanesulfonate |
| PubChem CID | 5277834 |
| Molecular Formula | C16H12BrClN2O5S |
| Molecular Weight | 459.71 g/mol |
| Exact Mass | 457.93 |
| IUPAC Name | [7-bromo-2-[(3-chlorophenyl)methyl]-1,8-dioxopyrido[1,2-a]pyrazin-9-yl] methanesulfonate |
| SMILES | CS(=O)(=O)Oc1c(=O)c(Br)cn2ccn(Cc3cccc(Cl)c3)c(=O)c12 |
| InChI | InChI=1S/C16H12BrClN2O5S/c1-26(23,24)25-15-13-16(22)20(8-10-3-2-4-11(18)7-10)6-5-19(13)9-12(17)14(15)21/h2-7,9H,8H2,1H3 |
| InChIKey | HTVFBJUZKZIWQF-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 86.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 459.71 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|
Analyze [7-bromo-2-[(3-chlorophenyl)methyl]-1,8-dioxopyrido[1,2-a]pyrazin-9-yl] methanesulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [7-bromo-2-[(3-chlorophenyl)methyl]-1,8-dioxopyrido[1,2-a]pyrazin-9-yl] methanesulfonate?
The IUPAC name of [7-bromo-2-[(3-chlorophenyl)methyl]-1,8-dioxopyrido[1,2-a]pyrazin-9-yl] methanesulfonate (CID 5277834) is [7-bromo-2-[(3-chlorophenyl)methyl]-1,8-dioxopyrido[1,2-a]pyrazin-9-yl] methanesulfonate.
What is the SMILES notation for [7-bromo-2-[(3-chlorophenyl)methyl]-1,8-dioxopyrido[1,2-a]pyrazin-9-yl] methanesulfonate?
The canonical SMILES for [7-bromo-2-[(3-chlorophenyl)methyl]-1,8-dioxopyrido[1,2-a]pyrazin-9-yl] methanesulfonate is CS(=O)(=O)Oc1c(=O)c(Br)cn2ccn(Cc3cccc(Cl)c3)c(=O)c12.
What is the InChIKey of [7-bromo-2-[(3-chlorophenyl)methyl]-1,8-dioxopyrido[1,2-a]pyrazin-9-yl] methanesulfonate?
The InChIKey is HTVFBJUZKZIWQF-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H12BrClN2O5S/c1-26(23,24)25-15-13-16(22)20(8-10-3-2-4-11(18)7-10)6-5-19(13)9-12(17)14(15)21/h2-7,9H,8H2,1H3.
What are the key properties of [7-bromo-2-[(3-chlorophenyl)methyl]-1,8-dioxopyrido[1,2-a]pyrazin-9-yl] methanesulfonate?
[7-bromo-2-[(3-chlorophenyl)methyl]-1,8-dioxopyrido[1,2-a]pyrazin-9-yl] methanesulfonate has a molecular weight of 459.71 g/mol, XLogP of 2.26, 4 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for [7-bromo-2-[(3-chlorophenyl)methyl]-1,8-dioxopyrido[1,2-a]pyrazin-9-yl] methanesulfonate is sourced from PubChem (CID 5277834), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).