C14H25N3O5 — CID 5278238
(3S,4S)-4-amino-1-[4-carboxybutyl(propan-2-yl)carbamoyl]pyrrolidine-3-carboxylic acid (PubChem CID 5278238) has the molecular formula C14H25N3O5 and a molecular weight of 315.37 g/mol. Its IUPAC name is (3S,4S)-4-amino-1-[4-carboxybutyl(propan-2-yl)carbamoyl]pyrrolidine-3-carboxylic acid.
| Compound Name | (3S,4S)-4-amino-1-[4-carboxybutyl(propan-2-yl)carbamoyl]pyrrolidine-3-carboxylic acid |
|---|---|
| PubChem CID | 5278238 |
| Molecular Formula | C14H25N3O5 |
| Molecular Weight | 315.37 g/mol |
| Exact Mass | 315.18 |
| IUPAC Name | (3S,4S)-4-amino-1-[4-carboxybutyl(propan-2-yl)carbamoyl]pyrrolidine-3-carboxylic acid |
| SMILES | CC(C)N(CCCCC(=O)O)C(=O)N1C[C@@H](N)[C@@H](C(=O)O)C1 |
| InChI | InChI=1S/C14H25N3O5/c1-9(2)17(6-4-3-5-12(18)19)14(22)16-7-10(13(20)21)11(15)8-16/h9-11H,3-8,15H2,1-2H3,(H,18,19)(H,20,21)/t10-,11+/m0/s1 |
| InChIKey | YUKRHGUNODFUCU-WDEREUQCSA-N |
| XLogP | 0.42 |
| TPSA | 124.17 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.37 |
| LogP ≤ 5 | 0.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|