C32H26N6O8 — CID 5278274
[(2R,3R,4R,5R)-5-(4-amino-5-carbamoylpyrrolo[2,3-d]triazin-7-yl)-3,4-dibenzoyloxyoxolan-2-yl]methyl benzoate (PubChem CID 5278274) has the molecular formula C32H26N6O8 and a molecular weight of 622.59 g/mol. Its IUPAC name is [(2R,3R,4R,5R)-5-(4-amino-5-carbamoylpyrrolo[2,3-d]triazin-7-yl)-3,4-dibenzoyloxyoxolan-2-yl]methyl benzoate.
| Compound Name | [(2R,3R,4R,5R)-5-(4-amino-5-carbamoylpyrrolo[2,3-d]triazin-7-yl)-3,4-dibenzoyloxyoxolan-2-yl]methyl benzoate |
|---|---|
| PubChem CID | 5278274 |
| Molecular Formula | C32H26N6O8 |
| Molecular Weight | 622.59 g/mol |
| Exact Mass | 622.18 |
| IUPAC Name | [(2R,3R,4R,5R)-5-(4-amino-5-carbamoylpyrrolo[2,3-d]triazin-7-yl)-3,4-dibenzoyloxyoxolan-2-yl]methyl benzoate |
| SMILES | NC(=O)c1cn([C@@H]2O[C@H](COC(=O)c3ccccc3)[C@@H](OC(=O)c3ccccc3)[C@H]2OC(=O)c2ccccc2)c2nnnc(N)c12 |
| InChI | InChI=1S/C32H26N6O8/c33-26-23-21(27(34)39)16-38(28(23)36-37-35-26)29-25(46-32(42)20-14-8-3-9-15-20)24(45-31(41)19-12-6-2-7-13-19)22(44-29)17-43-30(40)18-10-4-1-5-11-18/h1-16,22,24-25,29H,17H2,(H2,34,39)(H2,33,35,36)/t22-,24-,25-,29-/m1/s1 |
| InChIKey | LYFDAEJYNXJVOS-UQCYUJMQSA-N |
| XLogP | 2.71 |
| TPSA | 200.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 622.59 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|