C33H27N7O7 — CID 5278283
[(2R,3R,4R,5R)-5-[4-[amino(methyl)amino]-5-cyanopyrrolo[2,3-d]triazin-7-yl]-3,4-dibenzoyloxyoxolan-2-yl]methyl benzoate (PubChem CID 5278283) has the molecular formula C33H27N7O7 and a molecular weight of 633.62 g/mol. Its IUPAC name is [(2R,3R,4R,5R)-5-[4-[amino(methyl)amino]-5-cyanopyrrolo[2,3-d]triazin-7-yl]-3,4-dibenzoyloxyoxolan-2-yl]methyl benzoate.
| Compound Name | [(2R,3R,4R,5R)-5-[4-[amino(methyl)amino]-5-cyanopyrrolo[2,3-d]triazin-7-yl]-3,4-dibenzoyloxyoxolan-2-yl]methyl benzoate |
|---|---|
| PubChem CID | 5278283 |
| Molecular Formula | C33H27N7O7 |
| Molecular Weight | 633.62 g/mol |
| Exact Mass | 633.20 |
| IUPAC Name | [(2R,3R,4R,5R)-5-[4-[amino(methyl)amino]-5-cyanopyrrolo[2,3-d]triazin-7-yl]-3,4-dibenzoyloxyoxolan-2-yl]methyl benzoate |
| SMILES | CN(N)c1nnnc2c1c(C#N)cn2[C@@H]1O[C@H](COC(=O)c2ccccc2)[C@@H](OC(=O)c2ccccc2)[C@H]1OC(=O)c1ccccc1 |
| InChI | InChI=1S/C33H27N7O7/c1-39(35)28-25-23(17-34)18-40(29(25)37-38-36-28)30-27(47-33(43)22-15-9-4-10-16-22)26(46-32(42)21-13-7-3-8-14-21)24(45-30)19-44-31(41)20-11-5-2-6-12-20/h2-16,18,24,26-27,30H,19,35H2,1H3/t24-,26-,27-,30-/m1/s1 |
| InChIKey | QGLXSTYZTHIRDQ-BQOYKFDPSA-N |
| XLogP | 3.21 |
| TPSA | 184.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 633.62 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|