About [2-(1,3-benzoxazol-2-yl)-2,2-difluoro-1-pyridin-3-ylethyl] acetate
[2-(1,3-benzoxazol-2-yl)-2,2-difluoro-1-pyridin-3-ylethyl] acetate (PubChem CID 5278376) has the molecular formula C16H12F2N2O3
and a molecular weight of 318.28 g/mol. Its IUPAC name is [2-(1,3-benzoxazol-2-yl)-2,2-difluoro-1-pyridin-3-ylethyl] acetate.
Molecular Properties
| Compound Name | [2-(1,3-benzoxazol-2-yl)-2,2-difluoro-1-pyridin-3-ylethyl] acetate |
| PubChem CID | 5278376 |
| Molecular Formula | C16H12F2N2O3 |
| Molecular Weight | 318.28 g/mol |
| Exact Mass | 318.08 |
| IUPAC Name | [2-(1,3-benzoxazol-2-yl)-2,2-difluoro-1-pyridin-3-ylethyl] acetate |
| SMILES | CC(=O)OC(c1cccnc1)C(F)(F)c1nc2ccccc2o1 |
| InChI | InChI=1S/C16H12F2N2O3/c1-10(21)22-14(11-5-4-8-19-9-11)16(17,18)15-20-12-6-2-3-7-13(12)23-15/h2-9,14H,1H3 |
| InChIKey | KWWRXWPOGLRRNR-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 65.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 318.28 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze [2-(1,3-benzoxazol-2-yl)-2,2-difluoro-1-pyridin-3-ylethyl] acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-(1,3-benzoxazol-2-yl)-2,2-difluoro-1-pyridin-3-ylethyl] acetate?
The IUPAC name of [2-(1,3-benzoxazol-2-yl)-2,2-difluoro-1-pyridin-3-ylethyl] acetate (CID 5278376) is [2-(1,3-benzoxazol-2-yl)-2,2-difluoro-1-pyridin-3-ylethyl] acetate.
What is the SMILES notation for [2-(1,3-benzoxazol-2-yl)-2,2-difluoro-1-pyridin-3-ylethyl] acetate?
The canonical SMILES for [2-(1,3-benzoxazol-2-yl)-2,2-difluoro-1-pyridin-3-ylethyl] acetate is CC(=O)OC(c1cccnc1)C(F)(F)c1nc2ccccc2o1.
What is the InChIKey of [2-(1,3-benzoxazol-2-yl)-2,2-difluoro-1-pyridin-3-ylethyl] acetate?
The InChIKey is KWWRXWPOGLRRNR-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H12F2N2O3/c1-10(21)22-14(11-5-4-8-19-9-11)16(17,18)15-20-12-6-2-3-7-13(12)23-15/h2-9,14H,1H3.
What are the key properties of [2-(1,3-benzoxazol-2-yl)-2,2-difluoro-1-pyridin-3-ylethyl] acetate?
[2-(1,3-benzoxazol-2-yl)-2,2-difluoro-1-pyridin-3-ylethyl] acetate has a molecular weight of 318.28 g/mol, XLogP of 3.62, 4 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [2-(1,3-benzoxazol-2-yl)-2,2-difluoro-1-pyridin-3-ylethyl] acetate is sourced from PubChem (CID 5278376), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).