C23H29N7O2 — CID 5278489
1-[5-[4-(2-ethyltetrazol-5-yl)phenoxy]-3-methylpentyl]-3-pyridin-4-ylimidazolidin-2-one (PubChem CID 5278489) has the molecular formula C23H29N7O2 and a molecular weight of 435.53 g/mol. Its IUPAC name is 1-[5-[4-(2-ethyltetrazol-5-yl)phenoxy]-3-methylpentyl]-3-pyridin-4-ylimidazolidin-2-one.
| Compound Name | 1-[5-[4-(2-ethyltetrazol-5-yl)phenoxy]-3-methylpentyl]-3-pyridin-4-ylimidazolidin-2-one |
|---|---|
| PubChem CID | 5278489 |
| Molecular Formula | C23H29N7O2 |
| Molecular Weight | 435.53 g/mol |
| Exact Mass | 435.24 |
| IUPAC Name | 1-[5-[4-(2-ethyltetrazol-5-yl)phenoxy]-3-methylpentyl]-3-pyridin-4-ylimidazolidin-2-one |
| SMILES | CCn1nnc(-c2ccc(OCCC(C)CCN3CCN(c4ccncc4)C3=O)cc2)n1 |
| InChI | InChI=1S/C23H29N7O2/c1-3-30-26-22(25-27-30)19-4-6-21(7-5-19)32-17-11-18(2)10-14-28-15-16-29(23(28)31)20-8-12-24-13-9-20/h4-9,12-13,18H,3,10-11,14-17H2,1-2H3 |
| InChIKey | QHRKYRPAFCRBPM-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 89.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.53 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |