C13H23N5O4 — CID 5278581
trans-(3R,4S)-3-[1-acetamido-2-(ethylamino)-2-oxoethyl]-4-(diaminomethylideneamino)cyclopentane-1-carboxylic acid (PubChem CID 5278581) has the molecular formula C13H23N5O4 and a molecular weight of 313.36 g/mol. Its IUPAC name is trans-(3R,4S)-3-[1-acetamido-2-(ethylamino)-2-oxoethyl]-4-(diaminomethylideneamino)cyclopentane-1-carboxylic acid.
| Compound Name | trans-(3R,4S)-3-[1-acetamido-2-(ethylamino)-2-oxoethyl]-4-(diaminomethylideneamino)cyclopentane-1-carboxylic acid |
|---|---|
| PubChem CID | 5278581 |
| Molecular Formula | C13H23N5O4 |
| Molecular Weight | 313.36 g/mol |
| Exact Mass | 313.18 |
| IUPAC Name | trans-(3R,4S)-3-[1-acetamido-2-(ethylamino)-2-oxoethyl]-4-(diaminomethylideneamino)cyclopentane-1-carboxylic acid |
| SMILES | CCNC(=O)C(NC(C)=O)[C@H]1CC(C(=O)O)C[C@@H]1N=C(N)N |
| InChI | InChI=1S/C13H23N5O4/c1-3-16-11(20)10(17-6(2)19)8-4-7(12(21)22)5-9(8)18-13(14)15/h7-10H,3-5H2,1-2H3,(H,16,20)(H,17,19)(H,21,22)(H4,14,15,18)/t7?,8-,9-,10?/m0/s1 |
| InChIKey | FRVVUQDKIOAECE-ZNHWEVIXSA-N |
| XLogP | -1.62 |
| TPSA | 159.90 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.36 |
| LogP ≤ 5 | -1.62 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|