C17H29N5O4 — CID 5278616
trans-(3R,4S)-3-[1-acetamido-2-(azepan-1-yl)-2-oxoethyl]-4-(diaminomethylideneamino)cyclopentane-1-carboxylic acid (PubChem CID 5278616) has the molecular formula C17H29N5O4 and a molecular weight of 367.45 g/mol. Its IUPAC name is trans-(3R,4S)-3-[1-acetamido-2-(azepan-1-yl)-2-oxoethyl]-4-(diaminomethylideneamino)cyclopentane-1-carboxylic acid.
| Compound Name | trans-(3R,4S)-3-[1-acetamido-2-(azepan-1-yl)-2-oxoethyl]-4-(diaminomethylideneamino)cyclopentane-1-carboxylic acid |
|---|---|
| PubChem CID | 5278616 |
| Molecular Formula | C17H29N5O4 |
| Molecular Weight | 367.45 g/mol |
| Exact Mass | 367.22 |
| IUPAC Name | trans-(3R,4S)-3-[1-acetamido-2-(azepan-1-yl)-2-oxoethyl]-4-(diaminomethylideneamino)cyclopentane-1-carboxylic acid |
| SMILES | CC(=O)NC(C(=O)N1CCCCCC1)[C@H]1CC(C(=O)O)C[C@@H]1N=C(N)N |
| InChI | InChI=1S/C17H29N5O4/c1-10(23)20-14(15(24)22-6-4-2-3-5-7-22)12-8-11(16(25)26)9-13(12)21-17(18)19/h11-14H,2-9H2,1H3,(H,20,23)(H,25,26)(H4,18,19,21)/t11?,12-,13-,14?/m0/s1 |
| InChIKey | ONDGAGSDFXOEEL-QPPOZKHWSA-N |
| XLogP | -0.35 |
| TPSA | 151.11 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.45 |
| LogP ≤ 5 | -0.35 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|