About O-[2-(1,3-dioxoisoindol-2-yl)ethyl] N-[4-(dimethylamino)phenyl]carbamothioate
O-[2-(1,3-dioxoisoindol-2-yl)ethyl] N-[4-(dimethylamino)phenyl]carbamothioate (PubChem CID 5278691) has the molecular formula C19H19N3O3S
and a molecular weight of 369.45 g/mol. Its IUPAC name is O-[2-(1,3-dioxoisoindol-2-yl)ethyl] N-[4-(dimethylamino)phenyl]carbamothioate.
Molecular Properties
| Compound Name | O-[2-(1,3-dioxoisoindol-2-yl)ethyl] N-[4-(dimethylamino)phenyl]carbamothioate |
| PubChem CID | 5278691 |
| Molecular Formula | C19H19N3O3S |
| Molecular Weight | 369.45 g/mol |
| Exact Mass | 369.11 |
| IUPAC Name | O-[2-(1,3-dioxoisoindol-2-yl)ethyl] N-[4-(dimethylamino)phenyl]carbamothioate |
| SMILES | CN(C)c1ccc(NC(=S)OCCN2C(=O)c3ccccc3C2=O)cc1 |
| InChI | InChI=1S/C19H19N3O3S/c1-21(2)14-9-7-13(8-10-14)20-19(26)25-12-11-22-17(23)15-5-3-4-6-16(15)18(22)24/h3-10H,11-12H2,1-2H3,(H,20,26) |
| InChIKey | NEVXDIOEAPPRJU-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 61.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 369.45 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze O-[2-(1,3-dioxoisoindol-2-yl)ethyl] N-[4-(dimethylamino)phenyl]carbamothioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of O-[2-(1,3-dioxoisoindol-2-yl)ethyl] N-[4-(dimethylamino)phenyl]carbamothioate?
The IUPAC name of O-[2-(1,3-dioxoisoindol-2-yl)ethyl] N-[4-(dimethylamino)phenyl]carbamothioate (CID 5278691) is O-[2-(1,3-dioxoisoindol-2-yl)ethyl] N-[4-(dimethylamino)phenyl]carbamothioate.
What is the SMILES notation for O-[2-(1,3-dioxoisoindol-2-yl)ethyl] N-[4-(dimethylamino)phenyl]carbamothioate?
The canonical SMILES for O-[2-(1,3-dioxoisoindol-2-yl)ethyl] N-[4-(dimethylamino)phenyl]carbamothioate is CN(C)c1ccc(NC(=S)OCCN2C(=O)c3ccccc3C2=O)cc1.
What is the InChIKey of O-[2-(1,3-dioxoisoindol-2-yl)ethyl] N-[4-(dimethylamino)phenyl]carbamothioate?
The InChIKey is NEVXDIOEAPPRJU-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H19N3O3S/c1-21(2)14-9-7-13(8-10-14)20-19(26)25-12-11-22-17(23)15-5-3-4-6-16(15)18(22)24/h3-10H,11-12H2,1-2H3,(H,20,26).
What are the key properties of O-[2-(1,3-dioxoisoindol-2-yl)ethyl] N-[4-(dimethylamino)phenyl]carbamothioate?
O-[2-(1,3-dioxoisoindol-2-yl)ethyl] N-[4-(dimethylamino)phenyl]carbamothioate has a molecular weight of 369.45 g/mol, XLogP of 2.76, 5 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for O-[2-(1,3-dioxoisoindol-2-yl)ethyl] N-[4-(dimethylamino)phenyl]carbamothioate is sourced from PubChem (CID 5278691), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).