C21H18FN3O2 — CID 52787632
6-(4-fluorophenoxy)-N'-[(E)-3-phenylprop-2-enoxy]pyridine-3-carboximidamide (PubChem CID 52787632) has the molecular formula C21H18FN3O2 and a molecular weight of 363.39 g/mol. Its IUPAC name is 6-(4-fluorophenoxy)-N'-[(E)-3-phenylprop-2-enoxy]pyridine-3-carboximidamide.
| Compound Name | 6-(4-fluorophenoxy)-N'-[(E)-3-phenylprop-2-enoxy]pyridine-3-carboximidamide |
|---|---|
| PubChem CID | 52787632 |
| Molecular Formula | C21H18FN3O2 |
| Molecular Weight | 363.39 g/mol |
| Exact Mass | 363.14 |
| IUPAC Name | 6-(4-fluorophenoxy)-N'-[(E)-3-phenylprop-2-enoxy]pyridine-3-carboximidamide |
| SMILES | N/C(=N\OC/C=C/c1ccccc1)c1ccc(Oc2ccc(F)cc2)nc1 |
| InChI | InChI=1S/C21H18FN3O2/c22-18-9-11-19(12-10-18)27-20-13-8-17(15-24-20)21(23)25-26-14-4-7-16-5-2-1-3-6-16/h1-13,15H,14H2,(H2,23,25)/b7-4+ |
| InChIKey | YKEPBUWZBMCVMX-QPJJXVBHSA-N |
| XLogP | 4.36 |
| TPSA | 69.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.39 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|