C26H30N2O4 — CID 5278793
benzyl 1-[2-(cyclohexylmethylamino)-2-oxo-1-phenylethyl]-4-oxoazetidine-2-carboxylate (PubChem CID 5278793) has the molecular formula C26H30N2O4 and a molecular weight of 434.54 g/mol. Its IUPAC name is benzyl 1-[2-(cyclohexylmethylamino)-2-oxo-1-phenylethyl]-4-oxoazetidine-2-carboxylate.
| Compound Name | benzyl 1-[2-(cyclohexylmethylamino)-2-oxo-1-phenylethyl]-4-oxoazetidine-2-carboxylate |
|---|---|
| PubChem CID | 5278793 |
| Molecular Formula | C26H30N2O4 |
| Molecular Weight | 434.54 g/mol |
| Exact Mass | 434.22 |
| IUPAC Name | benzyl 1-[2-(cyclohexylmethylamino)-2-oxo-1-phenylethyl]-4-oxoazetidine-2-carboxylate |
| SMILES | O=C(OCc1ccccc1)C1CC(=O)N1C(C(=O)NCC1CCCCC1)c1ccccc1 |
| InChI | InChI=1S/C26H30N2O4/c29-23-16-22(26(31)32-18-20-12-6-2-7-13-20)28(23)24(21-14-8-3-9-15-21)25(30)27-17-19-10-4-1-5-11-19/h2-3,6-9,12-15,19,22,24H,1,4-5,10-11,16-18H2,(H,27,30) |
| InChIKey | HELMGFSLIAOCLN-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.54 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |