C26H29FN4O5 — CID 5278907
(2R)-2-[[4-[4-[(2-fluoro-5-methylphenoxy)methyl]piperidin-1-yl]phenoxy]methyl]-2-methyl-6-nitro-3H-imidazo[2,1-b][1,3]oxazole (PubChem CID 5278907) has the molecular formula C26H29FN4O5 and a molecular weight of 496.54 g/mol. Its IUPAC name is (2R)-2-[[4-[4-[(2-fluoro-5-methylphenoxy)methyl]piperidin-1-yl]phenoxy]methyl]-2-methyl-6-nitro-3H-imidazo[2,1-b][1,3]oxazole.
| Compound Name | (2R)-2-[[4-[4-[(2-fluoro-5-methylphenoxy)methyl]piperidin-1-yl]phenoxy]methyl]-2-methyl-6-nitro-3H-imidazo[2,1-b][1,3]oxazole |
|---|---|
| PubChem CID | 5278907 |
| Molecular Formula | C26H29FN4O5 |
| Molecular Weight | 496.54 g/mol |
| Exact Mass | 496.21 |
| IUPAC Name | (2R)-2-[[4-[4-[(2-fluoro-5-methylphenoxy)methyl]piperidin-1-yl]phenoxy]methyl]-2-methyl-6-nitro-3H-imidazo[2,1-b][1,3]oxazole |
| SMILES | Cc1ccc(F)c(OCC2CCN(c3ccc(OC[C@@]4(C)Cn5cc([N+](=O)[O-])nc5O4)cc3)CC2)c1 |
| InChI | InChI=1S/C26H29FN4O5/c1-18-3-8-22(27)23(13-18)34-15-19-9-11-29(12-10-19)20-4-6-21(7-5-20)35-17-26(2)16-30-14-24(31(32)33)28-25(30)36-26/h3-8,13-14,19H,9-12,15-17H2,1-2H3/t26-/m1/s1 |
| InChIKey | SQPKXPLNASYIDP-AREMUKBSSA-N |
| XLogP | 4.76 |
| TPSA | 91.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.54 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|