C30H39F2N3O5 — CID 5278976
(2S)-N-[(2R)-butan-2-yl]-4,4-difluoro-1-[(2S,3S)-2-hydroxy-3-[(3-hydroxy-2,5-dimethylbenzoyl)amino]-4-phenylbutanoyl]-3,3-dimethylpyrrolidine-2-carboxamide (PubChem CID 5278976) has the molecular formula C30H39F2N3O5 and a molecular weight of 559.65 g/mol. Its IUPAC name is (2S)-N-[(2R)-butan-2-yl]-4,4-difluoro-1-[(2S,3S)-2-hydroxy-3-[(3-hydroxy-2,5-dimethylbenzoyl)amino]-4-phenylbutanoyl]-3,3-dimethylpyrrolidine-2-carboxamide.
| Compound Name | (2S)-N-[(2R)-butan-2-yl]-4,4-difluoro-1-[(2S,3S)-2-hydroxy-3-[(3-hydroxy-2,5-dimethylbenzoyl)amino]-4-phenylbutanoyl]-3,3-dimethylpyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 5278976 |
| Molecular Formula | C30H39F2N3O5 |
| Molecular Weight | 559.65 g/mol |
| Exact Mass | 559.29 |
| IUPAC Name | (2S)-N-[(2R)-butan-2-yl]-4,4-difluoro-1-[(2S,3S)-2-hydroxy-3-[(3-hydroxy-2,5-dimethylbenzoyl)amino]-4-phenylbutanoyl]-3,3-dimethylpyrrolidine-2-carboxamide |
| SMILES | CC[C@@H](C)NC(=O)[C@H]1N(C(=O)[C@@H](O)[C@H](Cc2ccccc2)NC(=O)c2cc(C)cc(O)c2C)CC(F)(F)C1(C)C |
| InChI | InChI=1S/C30H39F2N3O5/c1-7-18(3)33-27(39)25-29(5,6)30(31,32)16-35(25)28(40)24(37)22(15-20-11-9-8-10-12-20)34-26(38)21-13-17(2)14-23(36)19(21)4/h8-14,18,22,24-25,36-37H,7,15-16H2,1-6H3,(H,33,39)(H,34,38)/t18-,22+,24+,25-/m1/s1 |
| InChIKey | BZVPDWZHOZILFP-QVJDATKISA-N |
| XLogP | 3.50 |
| TPSA | 118.97 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 559.65 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |