C25H36N2O7S — CID 5279193
tert-butyl N-[(2S,3R)-3-hydroxy-4-[(4-methoxyphenyl)sulfonyl-propan-2-yloxyamino]-1-phenylbutan-2-yl]carbamate (PubChem CID 5279193) has the molecular formula C25H36N2O7S and a molecular weight of 508.64 g/mol. Its IUPAC name is tert-butyl N-[(2S,3R)-3-hydroxy-4-[(4-methoxyphenyl)sulfonyl-propan-2-yloxyamino]-1-phenylbutan-2-yl]carbamate.
| Compound Name | tert-butyl N-[(2S,3R)-3-hydroxy-4-[(4-methoxyphenyl)sulfonyl-propan-2-yloxyamino]-1-phenylbutan-2-yl]carbamate |
|---|---|
| PubChem CID | 5279193 |
| Molecular Formula | C25H36N2O7S |
| Molecular Weight | 508.64 g/mol |
| Exact Mass | 508.22 |
| IUPAC Name | tert-butyl N-[(2S,3R)-3-hydroxy-4-[(4-methoxyphenyl)sulfonyl-propan-2-yloxyamino]-1-phenylbutan-2-yl]carbamate |
| SMILES | COc1ccc(S(=O)(=O)N(C[C@@H](O)[C@H](Cc2ccccc2)NC(=O)OC(C)(C)C)OC(C)C)cc1 |
| InChI | InChI=1S/C25H36N2O7S/c1-18(2)34-27(35(30,31)21-14-12-20(32-6)13-15-21)17-23(28)22(16-19-10-8-7-9-11-19)26-24(29)33-25(3,4)5/h7-15,18,22-23,28H,16-17H2,1-6H3,(H,26,29)/t22-,23+/m0/s1 |
| InChIKey | HPMPARPJICICTB-XZOQPEGZSA-N |
| XLogP | 3.52 |
| TPSA | 114.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.64 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|