C27H40N2O7S — CID 5279194
tert-butyl N-[(2S,3R)-3-hydroxy-4-[(4-methoxyphenyl)sulfonyl-pentan-3-yloxyamino]-1-phenylbutan-2-yl]carbamate (PubChem CID 5279194) has the molecular formula C27H40N2O7S and a molecular weight of 536.69 g/mol. Its IUPAC name is tert-butyl N-[(2S,3R)-3-hydroxy-4-[(4-methoxyphenyl)sulfonyl-pentan-3-yloxyamino]-1-phenylbutan-2-yl]carbamate.
| Compound Name | tert-butyl N-[(2S,3R)-3-hydroxy-4-[(4-methoxyphenyl)sulfonyl-pentan-3-yloxyamino]-1-phenylbutan-2-yl]carbamate |
|---|---|
| PubChem CID | 5279194 |
| Molecular Formula | C27H40N2O7S |
| Molecular Weight | 536.69 g/mol |
| Exact Mass | 536.26 |
| IUPAC Name | tert-butyl N-[(2S,3R)-3-hydroxy-4-[(4-methoxyphenyl)sulfonyl-pentan-3-yloxyamino]-1-phenylbutan-2-yl]carbamate |
| SMILES | CCC(CC)ON(C[C@@H](O)[C@H](Cc1ccccc1)NC(=O)OC(C)(C)C)S(=O)(=O)c1ccc(OC)cc1 |
| InChI | InChI=1S/C27H40N2O7S/c1-7-21(8-2)36-29(37(32,33)23-16-14-22(34-6)15-17-23)19-25(30)24(18-20-12-10-9-11-13-20)28-26(31)35-27(3,4)5/h9-17,21,24-25,30H,7-8,18-19H2,1-6H3,(H,28,31)/t24-,25+/m0/s1 |
| InChIKey | KBIPGDRYFVMXGQ-LOSJGSFVSA-N |
| XLogP | 4.30 |
| TPSA | 114.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.69 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|